![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[ ]](/icons/unknown.gif) | Office-2019.x64 - XYZ.rar | 2024-11-29 21:28 | 6.4G | |
![[ ]](/icons/unknown.gif) | Win10_22H2_Spanish_x64v1 - XYZ.rar | 2025-08-27 22:07 | 5.7G | |
![[VID]](/icons/movie.gif) | Felicidad para principiantes (2023) [Bluray 720p][Esp](wolfmax4k.com).mp4 | 2024-05-08 03:45 | 5.2G | |
![[VID]](/icons/movie.gif) | Avatar.El.Camino.Del.Agua.2022.1080p-dual-lat.mp4 | 2024-05-07 18:29 | 3.8G | |
![[VID]](/icons/movie.gif) | Espía.A.La.Caza.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:17 | 2.8G | |
![[VID]](/icons/movie.gif) | Indiana.Jones.and.the.Dial.of.Destiny.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:52 | 2.8G | |
![[VID]](/icons/movie.gif) | Teen.Wolf-.La.Pelicula.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 2.6G | |
![[VID]](/icons/movie.gif) | El.Curandero.2023.1080P-Dual-Lat.mp4 | 2024-05-05 19:57 | 2.5G | |
![[VID]](/icons/movie.gif) | Sospechoso.X.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:55 | 2.5G | |
![[VID]](/icons/movie.gif) | Érase.Una.Vez.Una.Estrella.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:02 | 2.5G | |
![[VID]](/icons/movie.gif) | Call.Me.Chihiro.2023.1080p-dual-lat.mp4 | 2024-05-05 15:34 | 2.5G | |
![[VID]](/icons/movie.gif) | 10.Días.De.Un.Buen.Hombre.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:30 | 2.5G | |
![[VID]](/icons/movie.gif) | Reptiles.2023.1080P-Dual-Lat.mp4 | 2024-05-05 19:37 | 2.4G | |
![[VID]](/icons/movie.gif) | Luther.The.Fallen.Sun.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:38 | 2.4G | |
![[VID]](/icons/movie.gif) | 2.mp4 | 2024-05-04 22:54 | 2.4G | |
![[VID]](/icons/movie.gif) | Gran.Turismo.De.Jugador.A.Corredor.2023.1080P-Dual-Lat.mp4 | 2024-05-05 21:56 | 2.4G | |
![[VID]](/icons/movie.gif) | Jagun.Jagun.(The.Warrior)..2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:39 | 2.4G | |
![[VID]](/icons/movie.gif) | Tenemos.un.fantasma.2023.1080p-dual-lat.mp4 | 2024-05-05 15:03 | 2.4G | |
![[VID]](/icons/movie.gif) | Zom.100.Bucket.List.Of.The.Dead.2023.1080P-Dual-Lat.mp4 | 2024-05-08 02:11 | 2.3G | |
![[VID]](/icons/movie.gif) | Blue.Beetle.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:09 | 2.3G | |
![[VID]](/icons/movie.gif) | El.Capitán.Volkonogob.Ha.Huido.2021.1080P-Dual-Lat.mp4 | 2024-05-05 15:20 | 2.3G | |
![[VID]](/icons/movie.gif) | Heart.Of.Stone.2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:55 | 2.2G | |
![[VID]](/icons/movie.gif) | La.Libreta.Negra.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:17 | 2.2G | |
![[VID]](/icons/movie.gif) | Sonido.De.Libertad.2023.1080P-Dual-Lat.mp4 | 2024-05-08 13:23 | 2.2G | |
![[VID]](/icons/movie.gif) | Ustedes.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 2.2G | |
![[VID]](/icons/movie.gif) | Mansión.Embrujada2023.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:05 | 2.2G | |
![[VID]](/icons/movie.gif) | Dear.David.2023.1080p-dual-lat.mp4 | 2024-05-04 23:04 | 2.2G | |
![[VID]](/icons/movie.gif) | Unlocked.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 2.2G | |
![[VID]](/icons/movie.gif) | A.Millones.De.Kilómetros.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:40 | 2.2G | |
![[VID]](/icons/movie.gif) | The.Three.Musketeers.Dartagnan.2023.1080P-Dual-Lat.mp4 | 2024-05-08 01:30 | 2.2G | |
![[VID]](/icons/movie.gif) | La.Vida.Es.Un.Pastel.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:57 | 2.2G | |
![[VID]](/icons/movie.gif) | True.Spirit.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 2.2G | |
![[VID]](/icons/movie.gif) | The.Murderer.2023.1080P-Dual-Lat.mp4 | 2024-05-08 15:04 | 2.2G | |
![[VID]](/icons/movie.gif) | Escape.Bajo.Fuego.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:31 | 2.1G | |
![[VID]](/icons/movie.gif) | To.Catch.A.Killer.2023.1080P-Dual-Lat.mp4 | 2024-05-08 10:58 | 2.1G | |
![[VID]](/icons/movie.gif) | Tangos.Tequilas.Y.Algunas.Mentiras.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:47 | 2.1G | |
![[VID]](/icons/movie.gif) | Drácula.Mar.De.Sangre..2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:59 | 2.1G | |
![[VID]](/icons/movie.gif) | Pamela.A.Love.Story.2023.1080p-dual-lat.mp4 | 2024-05-05 14:38 | 2.1G | |
![[VID]](/icons/movie.gif) | American.Nightmare.Becoming.Cody.Rhodes.2023.1080P-Dual-Lat.mp4 | 2024-05-08 11:05 | 2.1G | |
![[VID]](/icons/movie.gif) | Disconnect.The.Wedding.Planner.2023.1080p-dual-lat.mp4 | 2024-05-04 23:04 | 2.1G | |
![[VID]](/icons/movie.gif) | Megalodón.2.El.Gran.Abismo.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:54 | 2.1G | |
![[VID]](/icons/movie.gif) | Your.Place.or.Mine.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 2.1G | |
![[VID]](/icons/movie.gif) | Juego.Limpio.2023.1080P-Dual-Lat.mp4 | 2024-05-05 17:49 | 2.1G | |
![[VID]](/icons/movie.gif) | No.Molestar.2023.1080P-Dual-Lat.mp4 | 2024-05-06 22:40 | 2.1G | |
![[VID]](/icons/movie.gif) | Barbie.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:12 | 2.0G | |
![[VID]](/icons/movie.gif) | Awareness.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:33 | 2.0G | |
![[VID]](/icons/movie.gif) | Dobles.De.Accion.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:17 | 2.0G | |
![[VID]](/icons/movie.gif) | Faraway.2023.1080p-Dual-Lat.mp4 | 2024-05-05 15:15 | 2.0G | |
![[VID]](/icons/movie.gif) | The.Machine.2023.1080P-Dual-Lat.mp4 | 2024-05-07 17:43 | 2.0G | |
![[VID]](/icons/movie.gif) | Chang.Can.Dunk.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:35 | 2.0G | |
![[VID]](/icons/movie.gif) | Alerta.Extrema.2023.1080p-dual-lat.mp4 | 2024-05-05 15:32 | 2.0G | |
![[VID]](/icons/movie.gif) | The.Devil.Conspiracy.2022.1080P-Dual-Lat.mp4 | 2024-05-07 02:56 | 2.0G | |
![[VID]](/icons/movie.gif) | La.Monja.2.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:57 | 2.0G | |
![[VID]](/icons/movie.gif) | Junge.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 2.0G | |
![[VID]](/icons/movie.gif) | Little.Dixie.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 2.0G | |
![[VID]](/icons/movie.gif) | 3.mp4 | 2024-05-04 22:54 | 2.0G | |
![[VID]](/icons/movie.gif) | Mi.Novia.Otaku..2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:40 | 1.9G | |
![[VID]](/icons/movie.gif) | Blood.2022.1080P-Dual-Lat.mp4 | 2024-05-07 03:35 | 1.9G | |
![[VID]](/icons/movie.gif) | Érase.Una.Vez.Un.Asesinato.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:51 | 1.9G | |
![[VID]](/icons/movie.gif) | Los.Bastardos..2022.1080P-Dual-Lat.mp4 | 2024-05-06 23:09 | 1.9G | |
![[VID]](/icons/movie.gif) | Somewhere.In.Queens.2022.1080P-Dual-Lat.mp4 | 2024-05-07 01:56 | 1.9G | |
![[VID]](/icons/movie.gif) | Eres.Tu.2023.1080P-Dual-cast.mp4 | 2024-05-05 15:18 | 1.9G | |
![[VID]](/icons/movie.gif) | Vacation.Friends.2.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:27 | 1.9G | |
![[VID]](/icons/movie.gif) | Dulces.Y.Sangrientos.16.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:54 | 1.9G | |
![[VID]](/icons/movie.gif) | Dog.Gone.2023.1080p-dual-lat.mp4 | 2024-05-05 14:17 | 1.9G | |
![[VID]](/icons/movie.gif) | Doble.Discurso.2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:26 | 1.9G | |
![[VID]](/icons/movie.gif) | Transfusion.2023.1080p-dual-lat.mp4 | 2024-05-05 14:47 | 1.9G | |
![[VID]](/icons/movie.gif) | Amor sexo y 30 velitas.2023.1080p.dual-lat.cinecalidad.com.mx.mp4 | 2024-05-08 00:49 | 1.9G | |
![[VID]](/icons/movie.gif) | La.Emboscada.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:41 | 1.9G | |
![[VID]](/icons/movie.gif) | El.Conde.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:48 | 1.9G | |
![[VID]](/icons/movie.gif) | House.Party.2023.1080p-dual-lat.mp4 | 2024-05-05 14:17 | 1.9G | |
![[VID]](/icons/movie.gif) | At Midnight.2023.1080p-dual-lat.mp4 | 2024-05-04 23:03 | 1.9G | |
![[VID]](/icons/movie.gif) | ¡No.Estás.Invitada.A.Mi.Bat.Mitzvá!..2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:19 | 1.9G | |
![[VID]](/icons/movie.gif) | Angela.2023.1080P-Dual-Lat.mp4 | 2024-05-05 16:46 | 1.9G | |
![[VID]](/icons/movie.gif) | Los.Extraños.2023.1080p-dual-lat.mp4 | 2024-05-05 14:57 | 1.9G | |
![[VID]](/icons/movie.gif) | 80.For.Brady.2023.1080p-Dual-Lat.mp4 | 2024-05-05 15:31 | 1.9G | |
![[VID]](/icons/movie.gif) | ¡Bienvenida,.Violeta!.2022.1080P-Dual-Lat.mp4 | 2024-05-05 16:20 | 1.8G | |
![[VID]](/icons/movie.gif) | No.Hard.Feelings.2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:18 | 1.8G | |
![[VID]](/icons/movie.gif) | Hidden.Strike.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:43 | 1.8G | |
![[VID]](/icons/movie.gif) | La.Clave.Del.Corazón.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:15 | 1.8G | |
![[VID]](/icons/movie.gif) | Nowhere.2023.1080P-Dual-Lat.mp4 | 2024-05-05 19:24 | 1.8G | |
![[VID]](/icons/movie.gif) | Tortugas.Ninja.Caos.Mutante..2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:28 | 1.8G | |
![[VID]](/icons/movie.gif) | Miraculous.Ladybug.And.Cat.Noir.The.Movie.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:41 | 1.8G | |
![[VID]](/icons/movie.gif) | Elemental.2023.1080P-Dual-Lat.mp4 | 2024-05-07 02:47 | 1.8G | |
![[VID]](/icons/movie.gif) | Breaking.Point.2023.1080P-Dual-Lat.mp4 | 2024-05-05 20:50 | 1.8G | |
![[VID]](/icons/movie.gif) | Malcriados.2022.1080p-dual-lat.mp4 | 2024-05-05 14:39 | 1.8G | |
![[VID]](/icons/movie.gif) | Carga.Máxima.2023.1080P-Dual-Lat.mp4 | 2024-05-05 20:05 | 1.8G | |
![[VID]](/icons/movie.gif) | A.Sunday.Affair.2023.1080p-dual-lat.mp4 | 2024-05-04 22:57 | 1.8G | |
![[VID]](/icons/movie.gif) | Soulcatcher.2023.1080P-Dual-Lat.mp4 | 2024-05-08 01:43 | 1.8G | |
![[VID]](/icons/movie.gif) | Sentinelle.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:44 | 1.8G | |
![[VID]](/icons/movie.gif) | Casi.Muerta.2023.1080P-Dual-Lat.mp4 | 2024-05-06 22:25 | 1.8G | |
![[VID]](/icons/movie.gif) | Héroe.Por.Encargo.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:25 | 1.8G | |
![[VID]](/icons/movie.gif) | Flow.Callejero.2.2023.1080P-Dual-Lat.mp4 | 2024-05-06 01:36 | 1.8G | |
![[VID]](/icons/movie.gif) | Sayen.2022.1080P-Dual-Lat.mp4 | 2024-05-05 14:38 | 1.8G | |
![[VID]](/icons/movie.gif) | Un.Extraño.Entre.Nosotras.2023.1080P-Dual-Lat.mp4 | 2024-05-07 02:27 | 1.7G | |
![[VID]](/icons/movie.gif) | Miniespías.Armagedón.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:23 | 1.7G | |
![[VID]](/icons/movie.gif) | The.List.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:39 | 1.7G | |
![[VID]](/icons/movie.gif) | The.Blackening.2022.1080P-Dual-Lat.mp4 | 2024-05-07 03:07 | 1.7G | |
![[VID]](/icons/movie.gif) | Flora.E.Hijo.2023.1080P-Dual-Lat.mp4 | 2024-05-06 02:42 | 1.7G | |
![[VID]](/icons/movie.gif) | Juntos.Pero.No.Revueltos.2023.1080p-nodual-lat.mp4 | 2024-05-05 14:25 | 1.7G | |
![[VID]](/icons/movie.gif) | Lupin.III.vs.Cats.Eye.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 1.7G | |
![[VID]](/icons/movie.gif) | El.Rey.Mono.2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:00 | 1.7G | |
![[VID]](/icons/movie.gif) | Tonight.Youre.Sleeping.with.Me.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:46 | 1.7G | |
![[VID]](/icons/movie.gif) | Huesera.The.Bone.Woman.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 1.7G | |
![[VID]](/icons/movie.gif) | One.Ranger.2023.1080P-Dual-Lat.mp4 | 2024-05-07 02:53 | 1.7G | |
![[VID]](/icons/movie.gif) | Noches.De.Verano.En.Taipéi..2023.1080P-Dual-Lat.mp4 | 2024-05-06 01:27 | 1.7G | |
![[VID]](/icons/movie.gif) | Soltera.Codiciada.2..2023.1080P-Dual-Lat.mp4 | 2024-05-06 22:42 | 1.7G | |
![[VID]](/icons/movie.gif) | Un.Día.Y.Medio.2023.1080P-Dual-Lat.mp4 | 2024-05-06 22:27 | 1.7G | |
![[VID]](/icons/movie.gif) | Hay.Algo.Mal.Con.Los.Niños.2023.1080p-dual-lat.mp4 | 2024-05-05 14:17 | 1.7G | |
![[VID]](/icons/movie.gif) | Dime.Lo.Que.Quieres.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:47 | 1.7G | |
![[VID]](/icons/movie.gif) | Agente.X.Última.Misión.2023.1080P-Dual-Lat.mp4 | 2024-05-04 22:58 | 1.7G | |
![[VID]](/icons/movie.gif) | Juego.Entre.Amigos.Despetar.De.Primavera.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:11 | 1.7G | |
![[VID]](/icons/movie.gif) | Detective.Knight.Independence.2023.1080p-dual-lat.mp4 | 2024-05-04 23:03 | 1.7G | |
![[VID]](/icons/movie.gif) | All.The.Places.2023.1080p-dual-lat.mp4 | 2024-05-04 23:02 | 1.7G | |
![[VID]](/icons/movie.gif) | Háblame.2022.1080P-Dual-Lat.mp4 | 2024-05-05 15:12 | 1.7G | |
![[VID]](/icons/movie.gif) | Brujería.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:32 | 1.7G | |
![[VID]](/icons/movie.gif) | Locas.En.Apuros.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:30 | 1.7G | |
![[VID]](/icons/movie.gif) | El.Monstruo.Dentro.De.Mí.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:31 | 1.7G | |
![[VID]](/icons/movie.gif) | Ehrengard.El.Arte.De.La.Seducción.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:45 | 1.7G | |
![[VID]](/icons/movie.gif) | Bird.Box.Barcelona.2023.1080P-Dual-Lat.mp4 | 2024-05-08 11:01 | 1.7G | |
![[VID]](/icons/movie.gif) | Head.To.Head.2023.1080P-Dual-Lat.mp4 | 2024-05-08 02:47 | 1.7G | |
![[VID]](/icons/movie.gif) | Infiesto.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 1.7G | |
![[VID]](/icons/movie.gif) | ¿Quieres.Ser.Mi.Hijo.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:33 | 1.7G | |
![[VID]](/icons/movie.gif) | Bailarina.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:27 | 1.7G | |
![[VID]](/icons/movie.gif) | Divina.Señal.2023.1080P-Dual-Lat.mp4 | 2024-05-08 01:52 | 1.7G | |
![[VID]](/icons/movie.gif) | S.O.S.Mamis.2-.Mosquita.Muerta..2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:40 | 1.7G | |
![[VID]](/icons/movie.gif) | Hypnotic.2023.1080P-Dual-Lat.mp4 | 2024-05-06 01:19 | 1.7G | |
![[VID]](/icons/movie.gif) | Hijos.De.Perra..2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:02 | 1.7G | |
![[VID]](/icons/movie.gif) | Happy.Ending..2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:12 | 1.7G | |
![[VID]](/icons/movie.gif) | Rabia.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:34 | 1.7G | |
![[VID]](/icons/movie.gif) | El.Tutor..2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:53 | 1.7G | |
![[VID]](/icons/movie.gif) | Asedio.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:50 | 1.7G | |
![[VID]](/icons/movie.gif) | Mi.Gran.Boda.Griega.3.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:45 | 1.7G | |
![[VID]](/icons/movie.gif) | Muti.Rituales.Mortales.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:39 | 1.6G | |
![[VID]](/icons/movie.gif) | Final feliz.2023.1080p.dual-lat.cinecalidad.com.mx.mp4 | 2024-05-07 02:25 | 1.6G | |
![[VID]](/icons/movie.gif) | Have.A.Nice.Day.2023.1080P-Dual-Lat.mp4 | 2024-05-05 15:13 | 1.6G | |
![[VID]](/icons/movie.gif) | Mumbai.Mafia.Police.vs.The.Underworld.2023.1080p-dual-lat.mp4 | 2024-05-05 14:38 | 1.6G | |
![[VID]](/icons/movie.gif) | Vida.Adulta..2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:38 | 1.6G | |
![[VID]](/icons/movie.gif) | Rey.De.Asesinos.2023.1080P-Dual-Lat.mp4 | 2024-05-05 17:41 | 1.6G | |
![[VID]](/icons/movie.gif) | La.Probabilidad.Estadística.Del.Amor.A.Primera.Vista.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:38 | 1.6G | |
![[VID]](/icons/movie.gif) | El.Sacramento.Del.Diablo.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:24 | 1.6G | |
![[VID]](/icons/movie.gif) | The.River.Wild.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:38 | 1.6G | |
![[VID]](/icons/movie.gif) | Rock.Dog.3-.Rockeando.Juntos..2022.1080p-dual-lat.mp4 | 2024-05-05 14:38 | 1.6G | |
![[VID]](/icons/movie.gif) | Casando.A.Mi.Ex.2023.1080p-dual-lat.mp4 | 2024-05-04 23:03 | 1.6G | |
![[VID]](/icons/movie.gif) | Contrarreloj.2023.1080P-Dual-Lat.mp4 | 2024-05-04 23:03 | 1.6G | |
![[VID]](/icons/movie.gif) | Sharper.2023.1080p-dual-lat.mp4 | 2024-05-05 14:38 | 1.6G | |
![[VID]](/icons/movie.gif) | The.Great.Seduction.2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:04 | 1.6G | |
![[VID]](/icons/movie.gif) | Scouts Honor Los archivos secretos de los Boy Scouts de EE. UU.2023.1080p.dual-lat.cinecalidad.com.mx.mp4 | 2024-05-06 02:09 | 1.6G | |
![[VID]](/icons/movie.gif) | El.Amor.Está.En.El.Aire.2023.1080P-Dual-Lat.mp4 | 2024-05-05 21:02 | 1.6G | |
![[VID]](/icons/movie.gif) | My.House.2023.1080P-Dual-Lat.mp4 | 2024-05-08 01:46 | 1.6G | |
![[VID]](/icons/movie.gif) | Freestyle.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:42 | 1.6G | |
![[VID]](/icons/movie.gif) | Los.Habitantes.2023.1080P-Dual-Lat.mp4 | 2024-05-08 11:03 | 1.6G | |
![[VID]](/icons/movie.gif) | Acusado.2023.1080P-Dual-Lat.mp4 | 2024-05-06 22:35 | 1.6G | |
![[VID]](/icons/movie.gif) | Cobweb.2023.1080P.Dual-Lat.mp4 | 2024-05-07 02:29 | 1.6G | |
![[VID]](/icons/movie.gif) | Die.Hart.The.Movie.2023.1080p-dual-lat.mp4 | 2024-05-05 15:36 | 1.6G | |
![[VID]](/icons/movie.gif) | Invitación.A.Un.Asesinato.2023.1080P-Dual-Lat.mp4 | 2024-05-05 19:11 | 1.6G | |
![[VID]](/icons/movie.gif) | Cementerio.De.Animales.El.Origen.2023.1080P-Dual-Lat.mp4 | 2024-05-05 17:45 | 1.6G | |
![[VID]](/icons/movie.gif) | Diario.De.Un.Viaje.Inesperado.2023.1080P-Dual-Lat.mp4 | 2024-05-08 12:01 | 1.6G | |
![[VID]](/icons/movie.gif) | One.Day.As.A.Lion.2023.1080P-Dual-Lat.mp4 | 2024-05-06 23:07 | 1.6G | |
![[VID]](/icons/movie.gif) | Nuestro.Amigo.Extraordinario..2023.1080P-Dual-Lat.mp4 | 2024-05-05 19:41 | 1.6G | |
![[VID]](/icons/movie.gif) | To.End.All.War.Oppenheimer.The.Atomic.Bomb.2023.1080P-Dual-Lat.mp4 | 2024-05-08 10:56 | 1.6G | |
![[VID]](/icons/movie.gif) | Legions.2023.1080p-dual-lat.mp4 | 2024-05-05 14:25 | 1.5G | |
![[VID]](/icons/movie.gif) | El.Pájaro.Loco.Se.Va.De.Campamento.2024.1080P-Dual-Lat.mp4 | 2024-05-05 14:17 | 1.5G | |
![[VID]](/icons/movie.gif) | Mercy..2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:34 | 1.5G | |
![[VID]](/icons/movie.gif) | La.Venganza.De.Jack..2023.1080P-Dual-Lat.mp4 | 2024-05-06 01:02 | 1.5G | |
![[VID]](/icons/movie.gif) | 1.mp4 | 2024-05-04 22:53 | 1.5G | |
![[VID]](/icons/movie.gif) | Moving.On.2022.1080P-Dual-Lat.mp4 | 2024-05-07 18:20 | 1.5G | |
![[VID]](/icons/movie.gif) | Ready.Jet.Go!.Space.Camp.2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:15 | 1.5G | |
![[VID]](/icons/movie.gif) | Meet.Me.In.Paris.2023.1080p-dual-lat.mp4 | 2024-05-05 14:38 | 1.5G | |
![[VID]](/icons/movie.gif) | Inquietud.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:18 | 1.5G | |
![[VID]](/icons/movie.gif) | Winnie.The.Pooh.Miel.Y.Sangre.2023.1080P-Dual-Lat.mp4 | 2024-05-05 17:35 | 1.5G | |
![[VID]](/icons/movie.gif) | Metalocalypse.Army.Of.The.Doomstar.2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:14 | 1.5G | |
![[VID]](/icons/movie.gif) | Killer.Book.Club.2023.1080P-Dual-Lat.mp4 | 2024-05-07 01:29 | 1.5G | |
![[VID]](/icons/movie.gif) | Desaparecida.El.Caso.Lucie.Blackman.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:49 | 1.5G | |
![[VID]](/icons/movie.gif) | Lincessa..Los.Silencios.Del.Bosque..2023.1080P-Dual-Cast.mp4 | 2024-05-07 18:23 | 1.5G | |
![[VID]](/icons/movie.gif) | Fatum..2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:25 | 1.5G | |
![[VID]](/icons/movie.gif) | Chef.Jack -.El.Cocinero.Aventurero.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:01 | 1.4G | |
![[VID]](/icons/movie.gif) | Mortal.Kombat.Legends.Demonios.Y.Angeles.2023.1080P-Dual-Lat.mp4 | 2024-05-05 14:39 | 1.4G | |
![[VID]](/icons/movie.gif) | Untold.Hall.Of.Shame.2023.1080P-Dual-Lat.mp4 | 2024-05-07 02:57 | 1.4G | |
![[VID]](/icons/movie.gif) | Scooby-Doo.Y.Krypto.Al.Rescate.2023.1080P-Dual-Lat.mp4 | 2024-05-05 22:42 | 1.4G | |
![[VID]](/icons/movie.gif) | Harley Quinn - A Very Problematic Valentines Day Special.1080p.dual-lat.cinecalidad.run.mp4 | 2024-05-05 14:16 | 1.3G | |
![[VID]](/icons/movie.gif) | Abusamos del alcohol.2023.LAT.cinecalidad.com.mx.mp4 | 2024-05-07 18:32 | 1.3G | |
![[VID]](/icons/movie.gif) | Al.Descubierto.Johnny.Football..2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:31 | 1.3G | |
![[VID]](/icons/movie.gif) | Untold.Jake.Paul.The.Problem.Child.2023.1080P-Dual-Lat.mp4 | 2024-05-08 03:34 | 1.3G | |
![[VID]](/icons/movie.gif) | Lo.Desconocido.Los.Robots.Asesinos.2023.1080P-Dual-Lat.mp4 | 2024-05-08 11:59 | 1.3G | |
![[VID]](/icons/movie.gif) | When.Frank.Met.Carlitos.2023.1080P-Dual-Lat.mp4 | 2024-05-07 03:25 | 1.2G | |
![[VID]](/icons/movie.gif) | The.Seven.Deadly.Sins.Grudge.Of.Edinburgh.Part.2.2023.1080P-Dual-Lat.mp4 | 2024-05-07 18:11 | 1.0G | |
![[ ]](/icons/compressed.gif) | Oficina.zip | 2026-08-26 22:13 | 897M | |
![[VID]](/icons/movie.gif) | La.Maravillosa.Historia.De.Henry.Sugar.2023.1080P-Dual-Lat.mp4 | 2024-05-05 21:42 | 755M | |
![[VID]](/icons/movie.gif) | LEGO.Disney.Princess.The.Castle.Quest.2023.DVDRip-Lat.mp4 | 2024-05-07 03:44 | 739M | |
![[VID]](/icons/movie.gif) | Ver d0wnt0wn 0wl 2023 hdrip 1080p latino mp4.mp4 | 2024-05-05 15:48 | 729M | |
![[VID]](/icons/movie.gif) | Snoopy.Presents.One-Of-A-Kind.Marcie.2023.1080P-Dual-Lat.mp4 | 2024-05-07 02:44 | 717M | |
![[VID]](/icons/movie.gif) | El.Desratizador.2023.1080P-Dual-Lat.mp4 | 2024-05-06 00:47 | 327M | |
![[VID]](/icons/movie.gif) | El.Cisne.2023.1080P-Dual-Lat.mp4 | 2024-05-05 20:21 | 324M | |
![[VID]](/icons/movie.gif) | Veneno.2023.1080P-Dual-Lat.mp4 | 2024-05-05 18:22 | 323M | |
![[VID]](/icons/movie.gif) | La.Cita.De.Carl.2023.1080P-Dual-Lat.mp4 | 2024-05-05 23:15 | 160M | |
![[ ]](/icons/unknown.gif) | chr-7.20.img | 2025-09-30 17:53 | 128M | |
![[ ]](/icons/binary.gif) | Elibro-Desktop-V1-Setup-1.2.3_1.2.3.exe | 2026-08-26 22:18 | 66M | |
![[ ]](/icons/layout.gif) | El_hombre_como_pensador[1].pdf | 2026-08-26 22:18 | 59M | |
![[ ]](/icons/layout.gif) | Relaciones Entre Magnitudes(variables).pdf | 2026-08-26 22:18 | 57M | |
![[ ]](/icons/layout.gif) | Proyecto Técnico Armando Red.pdf | 2026-08-26 22:18 | 38M | |
![[ ]](/icons/unknown.gif) | magis-celular.apk | 2026-08-26 22:18 | 31M | |
![[ ]](/icons/binary.gif) | AutoCAD_2026_1_1_English-US_en-US_setup_webinstall.exe | 2026-08-26 22:17 | 29M | |
![[ ]](/icons/binary.gif) | Create_Installer_ACD_2026_1_1_Spanish_WIN64.exe | 2026-08-26 22:17 | 28M | |
![[ ]](/icons/layout.gif) | SUB BROKER Proyecto de Solares Punta Cana (2).pdf | 2026-08-26 22:18 | 23M | |
![[ ]](/icons/compressed.gif) | DGII_RNC(1).zip | 2026-08-26 22:17 | 20M | |
![[ ]](/icons/compressed.gif) | DGII_RNC.zip | 2026-08-26 22:17 | 20M | |
![[ ]](/icons/compressed.gif) | WinBox_Windows.zip | 2026-08-26 22:18 | 19M | |
![[ ]](/icons/compressed.gif) | WinBox_Windows(1).zip | 2026-08-26 22:18 | 19M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2026-01-25 at 9.25.09 AM.mp4 | 2026-08-26 22:18 | 18M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 6.45.22 PM.mp4 | 2026-08-26 22:18 | 16M | |
![[ ]](/icons/layout.gif) | Relaciones entre magnitudes.pdf | 2026-08-26 22:18 | 15M | |
![[SND]](/icons/sound2.gif) | Michael Jackson - Thriller (Lyrics).mp3 | 2026-08-26 22:18 | 14M | |
![[ ]](/icons/layout.gif) | Semana 3 de mas 30 PRODUCTOS en oferta CADA VIERNES (1).pdf | 2026-08-26 22:18 | 13M | |
![[ ]](/icons/layout.gif) | Semana 3 de mas 30 PRODUCTOS en oferta CADA VIERNES (1)-1.pdf | 2026-08-26 22:18 | 13M | |
![[ ]](/icons/layout.gif) | mapa-4.pdf | 2026-08-26 22:18 | 13M | |
![[ ]](/icons/layout.gif) | Semana 2 de mas 37 PRODUCTOS en oferta CADA VIERNES COMCAST GROUP.pdf | 2026-08-26 22:18 | 12M | |
![[ ]](/icons/layout.gif) | Semana 4 de mas 30 PRODUCTOS en oferta CADA VIERNES (2).pdf | 2026-08-26 22:18 | 12M | |
![[ ]](/icons/layout.gif) | PROPUESTA DE LOGO - LVC.pdf | 2026-08-26 22:18 | 12M | |
![[ ]](/icons/layout.gif) | PROPUESTA DE LOGO - LVC-1.pdf | 2026-08-26 22:18 | 12M | |
![[ ]](/icons/binary.gif) | FileZilla_3.69.6_win64-setup.exe | 2026-08-26 22:17 | 12M | |
![[ ]](/icons/binary.gif) | FileZilla_3.69.5_win64-setup.exe | 2026-08-26 22:17 | 12M | |
![[ ]](/icons/binary.gif) | FileZilla_3.70.6_win64-setup.exe | 2026-08-26 22:17 | 12M | |
![[ ]](/icons/binary.gif) | FileZilla_3.69.3_win64-setup.exe | 2026-08-26 22:17 | 12M | |
![[ ]](/icons/binary.gif) | WinSCP-6.5.4-Setup.exe | 2026-08-26 22:18 | 12M | |
![[SND]](/icons/sound2.gif) | Michael Jackson - Man In The Mirror (Official Video).mp3 | 2026-08-26 22:18 | 12M | |
![[ ]](/icons/layout.gif) | mapa-3.pdf | 2026-08-26 22:18 | 11M | |
![[ ]](/icons/binary.gif) | GoogleEarthProSetup.exe | 2026-08-26 22:18 | 11M | |
![[ ]](/icons/binary.gif) | GoogleEarthProSetup(1).exe | 2026-08-26 22:18 | 11M | |
![[ ]](/icons/layout.gif) | mapa-2.pdf | 2026-08-26 22:18 | 11M | |
![[VID]](/icons/movie.gif) | Ver Power Rangers La película Online Gratis HD - Cinecalidad.mp4 | 2026-08-26 22:18 | 10M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 10.32.05 AM.mp4 | 2026-08-26 22:18 | 10M | |
![[SND]](/icons/sound2.gif) | Mark Ronson - Uptown Funk (Official Video) ft. Bruno Mars.mp3 | 2026-08-26 22:18 | 10M | |
![[ ]](/icons/layout.gif) | división-territorial-2021.pdf | 2026-08-26 22:17 | 9.9M | |
![[ ]](/icons/unknown.gif) | app-debug.apk | 2026-08-26 22:16 | 9.8M | |
![[ ]](/icons/binary.gif) | ChromeSetup.exe | 2026-08-26 22:17 | 9.7M | |
![[SND]](/icons/sound2.gif) | Michael Jackson - Bad (lyrics).mp3 | 2026-08-26 22:18 | 9.4M | |
![[IMG]](/icons/image2.gif) | mapa.svg | 2026-08-26 22:18 | 9.2M | |
![[ ]](/icons/layout.gif) | Copia de Currículum Vitae CV de Mujer Minimalista Azul (1).pdf | 2026-08-26 22:17 | 8.7M | |
![[ ]](/icons/layout.gif) | 白と黒 シンプル 手書き風 写真 コラージュ 結婚 お知らせ インスタグラムストーリー.pdf | 2026-08-26 22:18 | 8.3M | |
![[SND]](/icons/sound2.gif) | House Of Pain - Jump Around (Official Lyric Video).mp3 | 2026-08-26 22:18 | 8.2M | |
![[ ]](/icons/binary.gif) | VaultClientLP_2026.2_esp.exe | 2026-08-26 22:18 | 8.2M | |
![[SND]](/icons/sound2.gif) | Yo La Tengo - zonacristiana.org.mp3 | 2026-08-26 22:18 | 7.8M | |
![[ ]](/icons/binary.gif) | AnyDesk.exe | 2026-08-26 22:16 | 7.6M | |
![[ ]](/icons/unknown.gif) | app-debug(5).apk | 2026-08-26 22:16 | 7.5M | |
![[ ]](/icons/unknown.gif) | app-debug(4).apk | 2026-08-26 22:16 | 7.5M | |
![[ ]](/icons/unknown.gif) | app-debug(3).apk | 2026-08-26 22:16 | 7.5M | |
![[ ]](/icons/unknown.gif) | app-debug(2).apk | 2026-08-26 22:16 | 7.5M | |
![[ ]](/icons/unknown.gif) | app-debug(1).apk | 2026-08-26 22:16 | 7.5M | |
![[SND]](/icons/sound2.gif) | Benson Boone - Beautiful Things (Official Music Video).mp3 | 2026-08-26 22:16 | 7.4M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 5.36.52 PM.mp4 | 2026-08-26 22:18 | 7.1M | |
![[VID]](/icons/movie.gif) | WhatsApp Audio 2026-02-26 at 4.58.23 PM.mp4 | 2026-08-26 22:18 | 6.3M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 9.56.21 AM.mp4 | 2026-08-26 22:18 | 6.2M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 9.56.21 AM(1).mp4 | 2026-08-26 22:18 | 6.2M | |
![[ ]](/icons/unknown.gif) | armando video(3).apk | 2026-08-26 22:16 | 6.1M | |
![[ ]](/icons/unknown.gif) | armando video(1).apk | 2025-06-17 13:43 | 6.1M | |
![[SND]](/icons/sound2.gif) | Si Tú Le Alaba - zonacristiana.org.mp3 | 2026-08-26 22:18 | 6.1M | |
![[ ]](/icons/unknown.gif) | Socialización Ejercicios de Retroalimentación de la 2da Evaluación Parcial.docx | 2026-08-26 22:18 | 5.7M | |
![[ ]](/icons/binary.gif) | EonVPNSetup(1).exe | 2026-08-26 22:17 | 5.6M | |
![[ ]](/icons/binary.gif) | wps_lid.lid-u9ywptSevPcm.exe | 2026-08-26 22:18 | 5.5M | |
![[ ]](/icons/binary.gif) | wps_wid.cid-544504898.1745608898.exe | 2026-08-26 22:18 | 5.4M | |
![[VID]](/icons/movie.gif) | GMT20250211-225811_Recording_1686x768.mp4 | 2026-08-26 22:17 | 5.2M | |
![[VID]](/icons/movie.gif) | GMT20250211-225811_Recording_1686x768(1).mp4 | 2026-08-26 22:17 | 5.2M | |
![[VID]](/icons/movie.gif) | WhatsApp Audio 2026-02-26 at 4.58.22 PM.mp4 | 2026-08-26 22:18 | 5.2M | |
![[ ]](/icons/layout.gif) | etiquetas-escolares-dinosaurios-editables-gratis.pdf | 2026-08-26 22:17 | 5.2M | |
![[ ]](/icons/compressed.gif) | IR-2-2018.zip | 2026-08-26 22:18 | 4.9M | |
![[ ]](/icons/layout.gif) | Catalogo 2024 Portasol Tableros (2).pdf | 2026-08-26 22:16 | 4.7M | |
![[ ]](/icons/unknown.gif) | 2C-POS80-01-V10 Windows Setup.rar | 2026-08-26 22:16 | 4.5M | |
![[ ]](/icons/layout.gif) | Diagramas Eléctricos Jeep Patriot 2WD 2.4L 2016.pdf | 2026-08-26 22:17 | 4.4M | |
![[ ]](/icons/layout.gif) | semiologia cabeza y cuello pediatria.pdf | 2026-08-26 22:18 | 4.3M | |
![[ ]](/icons/layout.gif) | Contrato de reventa 2026.pdf | 2026-08-26 22:17 | 4.2M | |
![[ ]](/icons/layout.gif) | Contrato de reventa 2026-1.pdf | 2026-08-26 22:17 | 4.2M | |
![[VID]](/icons/movie.gif) | De vuelta a clases con Armando Red 3.mp4 | 2026-08-26 22:17 | 4.2M | |
![[VID]](/icons/movie.gif) | De vuelta a clases con Armando Red 2.mp4 | 2026-08-26 22:17 | 4.2M | |
![[ ]](/icons/layout.gif) | Manual CTO Endocrinologia.pdf | 2026-08-26 22:18 | 4.2M | |
![[ ]](/icons/compressed.gif) | 20707v11954640_mapadelaciudaddesantiagodeloscaballerosrepublicadominicanasantiagodeloscaballerosrepublicadominicana.zip | 2026-08-26 22:16 | 4.1M | |
![[ ]](/icons/layout.gif) | CONTRATO DE REVENTA 15 OCTUBRE 2025.pdf | 2026-08-26 22:17 | 4.1M | |
![[ ]](/icons/layout.gif) | Contrato Reventa.pdf | 2026-08-26 22:17 | 4.1M | |
![[ ]](/icons/layout.gif) | Contrato Reventa-3.pdf | 2026-08-26 22:17 | 4.1M | |
![[ ]](/icons/layout.gif) | Contrato Reventa-2.pdf | 2026-08-26 22:17 | 4.1M | |
![[ ]](/icons/layout.gif) | Contrato Reventa-1.pdf | 2026-08-26 22:17 | 4.1M | |
![[ ]](/icons/compressed.gif) | Formato-de-Envio-606-(NG-07-2018-y-05-2019).zip | 2026-08-26 22:17 | 4.0M | |
![[ ]](/icons/layout.gif) | Manual infecto.pdf | 2026-08-26 22:18 | 3.9M | |
![[ ]](/icons/layout.gif) | Manual infecto-1.pdf | 2026-08-26 22:18 | 3.9M | |
![[ ]](/icons/layout.gif) | Contrato Reventa-2-1.pdf | 2026-08-26 22:17 | 3.9M | |
![[ ]](/icons/compressed.gif) | Formato606.zip | 2026-08-26 22:17 | 3.8M | |
![[ ]](/icons/binary.gif) | GLP_installer_900223156_com.dts.freefiremax.exe | 2026-08-26 22:17 | 3.7M | |
![[ ]](/icons/compressed.gif) | IT-1-2020.zip | 2026-08-26 22:18 | 3.6M | |
![[ ]](/icons/unknown.gif) | Clase del 15-09-2021 (008).docx | 2026-08-26 22:16 | 3.4M | |
![[ ]](/icons/compressed.gif) | Formato-de-Envio-607-(NG-07-2018-y-05-2019).zip | 2026-08-26 22:17 | 3.2M | |
![[ ]](/icons/layout.gif) | 196421005-Tilapia-Biofloc.pdf | 2026-08-26 22:16 | 3.2M | |
![[ ]](/icons/layout.gif) | 196421005-Tilapia-Biofloc-1.pdf | 2026-08-26 22:16 | 3.2M | |
![[VID]](/icons/movie.gif) | GMT20250211-225811_Recording.mp4 | 2026-08-26 22:17 | 3.1M | |
![[VID]](/icons/movie.gif) | GMT20250211-225811_Recording(1).mp4 | 2026-08-26 22:17 | 3.1M | |
![[ ]](/icons/layout.gif) | PDFReader_20241211_1427.pdf | 2026-08-26 22:18 | 3.1M | |
![[ ]](/icons/compressed.gif) | Documento A4 Hoja de Noticias Periódico Editorial Minimalista .zip | 2026-08-26 22:17 | 3.0M | |
![[ ]](/icons/compressed.gif) | Documento A4 Hoja de Noticias Periódico Editorial Minimalista (2).zip | 2026-08-26 22:17 | 3.0M | |
![[ ]](/icons/compressed.gif) | Documento A4 Hoja de Noticias Periódico Editorial Minimalista (1).zip | 2026-08-26 22:17 | 3.0M | |
![[ ]](/icons/unknown.gif) | CLASE 2 y 3 (días 2 y 3 -02-2021) (Material de consulta).docx | 2026-08-26 22:16 | 3.0M | |
![[VID]](/icons/movie.gif) | WhatsApp Video 2025-06-17 at 7.07.05 PM.mp4 | 2026-08-26 22:18 | 2.9M | |
![[IMG]](/icons/image2.gif) | mapa.png | 2026-08-26 22:18 | 2.8M | |
![[ ]](/icons/layout.gif) | PROM NOVIEMBRE.pdf | 2026-08-26 22:18 | 2.8M | |
![[ ]](/icons/layout.gif) | 5-InstructivoLlenadoyenvioFomato607.pdf | 2026-08-26 22:16 | 2.6M | |
![[ ]](/icons/layout.gif) | Manual_20CTO_20Nefrourologia.pdf | 2026-08-26 22:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Curso Acuicultura para el Cultivo de Tilapias - Febrero 2025_20250204_190610_0000.pdf | 2026-08-26 22:17 | 2.4M | |
![[ ]](/icons/layout.gif) | Curso Acuicultura para el Cultivo de Tilapias - Febrero 2025_20250204_190610_0000-1.pdf | 2026-08-26 22:17 | 2.4M | |
![[IMG]](/icons/image2.gif) | De vuelta a clases con Armando Red.png | 2026-08-26 22:17 | 2.3M | |
![[IMG]](/icons/image2.gif) | file_000000004f5c722fb14797504e6397ff.png | 2026-08-26 22:17 | 2.3M | |
![[ ]](/icons/binary.gif) | winbox64(1).exe | 2026-08-26 22:18 | 2.2M | |
![[ ]](/icons/binary.gif) | winbox64.exe | 2026-08-26 22:18 | 2.2M | |
![[IMG]](/icons/image2.gif) | Furgoneta Armando RED S.R.L. ventaja.png | 2026-08-26 22:17 | 2.1M | |
![[VID]](/icons/movie.gif) | De vuelta a clases con Armando Red 1.mp4 | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-11.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-10.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-9.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-8.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-7.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-6.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-5.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-4.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-3.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-2.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Despliegue General-1.pdf | 2026-08-26 22:17 | 2.0M | |
![[ ]](/icons/binary.gif) | rufus-4.14.exe | 2026-08-26 22:18 | 1.9M | |
![[VID]](/icons/movie.gif) | AQPumoe4wLQ3294A4gBW4pj4nRAaqzx7-EMW8RK4MHge0rC2h6SHZQ2mcwHGixYEM-16tXLz3Ia0o1M7Tu_BYYrtHEH5TE9z (online-video-cutter.com).mov | 2026-08-26 22:16 | 1.9M | |
![[ ]](/icons/layout.gif) | Documento A4 Feliz Cumpleaños Mensaje Elegante Sencillo Dorado.pdf | 2026-08-26 22:17 | 1.9M | |
![[ ]](/icons/layout.gif) | mapa-1.pdf | 2026-08-26 22:18 | 1.9M | |
![[IMG]](/icons/image2.gif) | ChatGPT Image 27 may 2026, 08_58_33.png | 2026-08-26 22:16 | 1.8M | |
![[ ]](/icons/layout.gif) | Manual hematologia cto.pdf | 2026-08-26 22:18 | 1.8M | |
![[ ]](/icons/layout.gif) | FAO_Enfoque ecosistémico a la acuicultura.pdf | 2026-08-26 22:17 | 1.7M | |
![[ ]](/icons/compressed.gif) | 80252v11954640_planodelaciudaddesantiagorepublicadominicanamapofthecityofsantiagodominicanrepublic.zip | 2026-08-26 22:16 | 1.7M | |
![[ ]](/icons/binary.gif) | NordVPNSetup.exe | 2026-08-26 22:18 | 1.7M | |
![[ ]](/icons/layout.gif) | tickets_VHBD1F6.pdf | 2026-08-26 22:18 | 1.6M | |
![[ ]](/icons/binary.gif) | rufus-4.7.exe | 2026-08-26 22:18 | 1.6M | |
![[IMG]](/icons/image2.gif) | ChatGPT Image 11 jun 2026, 16_26_03.png | 2026-08-26 22:16 | 1.6M | |
![[IMG]](/icons/image2.gif) | f5fe2dec-555b-46f9-921c-ec2e2f75b233.png | 2026-08-26 22:17 | 1.5M | |
![[ ]](/icons/unknown.gif) | trabajo de matematicas 2.docx | 2026-08-26 22:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | trabajo de matematicas (1).docx | 2026-08-26 22:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | jeremy.docx | 2026-08-26 22:18 | 1.5M | |
![[SND]](/icons/sound2.gif) | De Vuelta a Clases 3.mp3 | 2026-08-26 22:17 | 1.4M | |
![[ ]](/icons/layout.gif) | trabajo de matematicas 2.pdf | 2026-08-26 22:18 | 1.3M | |
![[SND]](/icons/sound2.gif) | De Vuelta a Clases 2.mp3 | 2026-08-26 22:17 | 1.3M | |
![[ ]](/icons/compressed.gif) | WhatsApp Unknown 2025-05-08 at 9.12.55 PM.zip | 2026-08-26 22:18 | 1.3M | |
![[VID]](/icons/movie.gif) | AQPumoe4wLQ3294A4gBW4pj4nRAaqzx7-EMW8RK4MHge0rC2h6SHZQ2mcwHGixYEM-16tXLz3Ia0o1M7Tu_BYYrtHEH5TE9z.mp4 | 2026-08-26 22:16 | 1.3M | |
![[ ]](/icons/layout.gif) | Despliegue Red Monte Adentro.pdf | 2026-08-26 22:17 | 1.2M | |
![[ ]](/icons/compressed.gif) | WhatsApp Unknown 2026-02-23 at 6.00.02 PM.zip | 2026-08-26 22:18 | 1.2M | |
![[ ]](/icons/compressed.gif) | 019bd7ce-98dd-430f-af2a-09af2e4f9e5d.zip | 2026-08-26 22:16 | 1.2M | |
![[ ]](/icons/layout.gif) | mapa.pdf | 2026-08-26 22:18 | 1.1M | |
![[ ]](/icons/unknown.gif) | trabajo de matematicas.docx | 2026-08-26 22:18 | 1.1M | |
![[ ]](/icons/binary.gif) | WhatsApp Installer.exe | 2026-08-26 22:18 | 1.1M | |
![[VID]](/icons/movie.gif) | Verano conectados.mp4 | 2026-08-26 22:18 | 1.0M | |
![[ ]](/icons/unknown.gif) | repaso sobre notacion cientifica y despeje de formulas.docx | 2026-08-26 22:18 | 1.0M | |
![[ ]](/icons/unknown.gif) | repaso sobre notacion cientifica y despeje de formulas(1).docx | 2026-08-26 22:18 | 1.0M | |
![[SND]](/icons/sound2.gif) | Aposento Alto - Dios, Patria Y Libertad - 01 En La Casa.mp3 | 2026-08-26 22:16 | 1.0M | |
![[ ]](/icons/layout.gif) | Despliegue Licey.pdf | 2026-08-26 22:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Despliegue Licey-3.pdf | 2026-08-26 22:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Despliegue Licey-2.pdf | 2026-08-26 22:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Despliegue Licey-1.pdf | 2026-08-26 22:17 | 1.0M | |
![[SND]](/icons/sound2.gif) | Aposento Alto - Dios, Patria Y Libertad - 02 Yo Voy Pa' Lante (Feat. El Varon Ima Cadete).mp3 | 2026-08-26 22:16 | 1.0M | |
![[ ]](/icons/binary.gif) | osgeo4w-setup.exe | 2026-08-26 22:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Despliegue Canca Abajo.pdf | 2026-08-26 22:17 | 1.0M | |
![[SND]](/icons/sound2.gif) | localnow.m3u | 2026-08-26 22:18 | 1.0M | |
![[ ]](/icons/compressed.gif) | MyAwesomeMap-01.zip | 2026-08-26 22:18 | 1.0M | |
![[SND]](/icons/sound2.gif) | Aposento Alto - Dios, Patria Y Libertad - 03 Solamente (Feat. Caleb).mp3 | 2026-08-26 22:16 | 957K | |
![[SND]](/icons/sound2.gif) | Aposento Alto - Dios, Patria Y Libertad - 04 Vive En Mi (Feat. Spiritual Bless).mp3 | 2026-08-26 22:16 | 905K | |
![[ ]](/icons/layout.gif) | 1-Guia 5-Comprobantes Fiscales.pdf | 2026-08-26 22:16 | 891K | |
![[ ]](/icons/layout.gif) | Unidad 1 - Ejemplos resueltos - Notación científica.pdf | 2026-08-26 22:18 | 885K | |
![[ ]](/icons/layout.gif) | Instructivo pagos Mi Campus.pdf | 2026-08-26 22:17 | 827K | |
![[ ]](/icons/layout.gif) | Guia-Basica-para-ser-Emisor-Electronico.pdf | 2026-08-26 22:17 | 825K | |
![[ ]](/icons/layout.gif) | Certificado medico.pdf | 2026-08-26 22:16 | 809K | |
![[SND]](/icons/sound2.gif) | Aposento Alto - Dios, Patria Y Libertad - 05 De Donde Soy (Feat. Nativo La Promesa Moises Pons).mp3 | 2026-08-26 22:16 | 792K | |
![[ ]](/icons/layout.gif) | TITULO JESU Y MAGDALENA.pdf | 2026-08-26 22:18 | 773K | |
![[ ]](/icons/unknown.gif) | img20260130_10104854.docx | 2026-08-26 22:17 | 700K | |
![[ ]](/icons/binary.gif) | sw-cfg.bin | 2026-08-26 22:18 | 697K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 06 de la 1era Evaluación.pdf | 2026-08-26 22:17 | 681K | |
![[ ]](/icons/layout.gif) | DE-0003267-25.pdf | 2026-08-26 22:17 | 676K | |
![[ ]](/icons/layout.gif) | DE-0003267-25-2.pdf | 2026-08-26 22:17 | 676K | |
![[ ]](/icons/layout.gif) | DE-0003267-25-1.pdf | 2026-08-26 22:17 | 676K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-01-27 at 14-30-44 Tabla Equivalencias Unidades Longitud PDF.png | 2026-08-26 22:18 | 654K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-01-27 at 14-30-17 Tabla Equivalencias Unidades Longitud PDF.png | 2026-08-26 22:18 | 654K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-7.pdf | 2026-08-26 22:17 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-6.pdf | 2026-08-26 22:17 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-5.pdf | 2026-08-26 22:17 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-4.pdf | 2026-08-26 22:17 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet.pdf | 2026-08-26 22:17 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-3.pdf | 2026-08-26 22:16 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-2.pdf | 2026-08-26 22:16 | 647K | |
![[ ]](/icons/layout.gif) | Contrato de Acceso al Servicio de Internet-1.pdf | 2026-08-26 22:16 | 647K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-06-24 at 15-13-10 Despliegue General.pdf.png | 2026-08-26 22:18 | 642K | |
![[ ]](/icons/unknown.gif) | 2C-POS80-02 Windows-Driver.rar | 2026-08-26 22:16 | 624K | |
![[ ]](/icons/unknown.gif) | 2C-POS80-02 Windows-Driver(2).rar | 2026-08-26 22:16 | 624K | |
![[ ]](/icons/unknown.gif) | 2C-POS80-02 Windows-Driver(1).rar | 2026-08-26 22:16 | 624K | |
![[ ]](/icons/compressed.gif) | 019d4513-0aa7-48fe-9075-178ef735da3f-attachments.zip | 2026-08-26 22:16 | 600K | |
![[ ]](/icons/compressed.gif) | 019d4513-0aa7-48fe-9075-178ef735da3f-attachments(2).zip | 2026-08-26 22:16 | 600K | |
![[ ]](/icons/compressed.gif) | 019d4513-0aa7-48fe-9075-178ef735da3f-attachments(1).zip | 2026-08-26 22:16 | 600K | |
![[SND]](/icons/sound2.gif) | De vuelta a clases 1.mp3 | 2026-08-26 22:17 | 599K | |
![[ ]](/icons/layout.gif) | COTIZACIÓN-1223.pdf | 2026-08-26 22:17 | 589K | |
![[ ]](/icons/layout.gif) | COTIZACIÓN-1223-1.pdf | 2026-08-26 22:17 | 589K | |
![[ ]](/icons/layout.gif) | IT-1.pdf | 2026-08-26 22:17 | 525K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-05-26 at 17-11-25 Diseños y promos anteriores.png | 2026-08-26 22:18 | 517K | |
![[ ]](/icons/layout.gif) | Copia de Armando Red Planos-Diagrama Unifilar.pdf | 2026-08-26 22:17 | 515K | |
![[IMG]](/icons/image2.gif) | ChatGPT Image 3 oct 2025, 16_23_09.png | 2026-08-26 22:16 | 509K | |
![[IMG]](/icons/image2.gif) | ChatGPT Image 3 oct 2025, 16_22_56.png | 2026-08-26 22:16 | 509K | |
![[ ]](/icons/layout.gif) | ANEXO A.pdf | 2026-08-26 22:16 | 507K | |
![[IMG]](/icons/image2.gif) | Coat_of_arms_of_the_Dominican_Republic.svg | 2026-08-26 22:16 | 504K | |
![[ ]](/icons/layout.gif) | S18-25-3407-12.pdf | 2026-08-26 22:18 | 493K | |
![[ ]](/icons/layout.gif) | DE-0002491-25.pdf | 2026-08-26 22:17 | 490K | |
![[ ]](/icons/layout.gif) | DE-0002491-25-1.pdf | 2026-08-26 22:17 | 490K | |
![[ ]](/icons/layout.gif) | Carta de Remisión de Documentos Indotel Armando RED.pdf | 2026-08-26 22:16 | 451K | |
![[ ]](/icons/layout.gif) | Carta de Remisión de Documentos Indotel Armando RED-2.pdf | 2026-08-26 22:16 | 451K | |
![[ ]](/icons/layout.gif) | Carta de Remisión de Documentos Indotel Armando RED-1.pdf | 2026-08-26 22:16 | 451K | |
![[ ]](/icons/layout.gif) | certificadoPDF-1.pdf | 2026-08-26 22:16 | 445K | |
![[ ]](/icons/layout.gif) | Comprobante_PagoTarjetaDeCredito_09_02_2026_10_27_25.pdf | 2026-08-26 22:16 | 435K | |
![[ ]](/icons/layout.gif) | Comprobante_PagoTarjetaDeCredito_09_02_2026_10_27_25 (1).pdf | 2026-08-26 22:16 | 435K | |
![[ ]](/icons/layout.gif) | cetificado bachiller LAWNNY SHANILL MARTINEZ VASQUEZ.pdf | 2026-08-26 22:16 | 426K | |
![[ ]](/icons/unknown.gif) | informe administracion.docx | 2026-08-26 22:17 | 425K | |
![[ ]](/icons/layout.gif) | certificadoPDF.pdf | 2026-08-26 22:16 | 418K | |
![[ ]](/icons/layout.gif) | Think Tides Fiber Module Price List(2025-06-04 19_48_31).pdf | 2026-08-26 22:18 | 412K | |
![[ ]](/icons/layout.gif) | DISEÑO DE UN PANEL ELECTRICO PAG 01.pdf | 2026-08-26 22:17 | 412K | |
![[ ]](/icons/layout.gif) | DISEÑO DE UN PANEL ELECTRICO PAG 01-1.pdf | 2026-08-26 22:17 | 412K | |
![[ ]](/icons/compressed.gif) | WhatsApp Unknown 2026-04-27 at 9.24.06 AM.zip | 2026-08-26 22:18 | 410K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(1).jpeg | 2026-08-26 22:18 | 387K | |
![[ ]](/icons/layout.gif) | Factura Radio Vision.pdf | 2026-08-26 22:17 | 386K | |
![[ ]](/icons/layout.gif) | Res._DE-032-2026_ARMANDO_RED_SRL-_Propuesta_de_Resolucion.pdf | 2026-08-26 22:18 | 386K | |
![[ ]](/icons/layout.gif) | New Documento de Microsoft Word (6).pdf | 2026-08-26 22:18 | 380K | |
![[ ]](/icons/layout.gif) | Cotización Lead. Nuevo _ Faustino Contreras Rincón (1).pdf | 2026-08-26 22:17 | 363K | |
![[ ]](/icons/layout.gif) | Práctica #2 de Lab de Física (2).pdf | 2026-08-26 22:18 | 351K | |
![[ ]](/icons/compressed.gif) | 019bd7ce-98dd-430f-af2a-09af2e4f9e5d-attachments.zip | 2026-08-26 22:16 | 344K | |
![[IMG]](/icons/image2.gif) | placeholder.png | 2026-08-26 22:18 | 339K | |
![[IMG]](/icons/image2.gif) | placeholder(3).png | 2026-08-26 22:18 | 339K | |
![[IMG]](/icons/image2.gif) | placeholder(2).png | 2026-08-26 22:18 | 339K | |
![[IMG]](/icons/image2.gif) | placeholder(1).png | 2026-08-26 22:18 | 339K | |
![[ ]](/icons/layout.gif) | RABDOMIOLIS.pdf | 2026-08-26 22:18 | 339K | |
![[ ]](/icons/layout.gif) | GUIA DE TRABAJO ELABORACION PANEL ELECTRICO (1).pdf | 2026-08-26 22:17 | 338K | |
![[ ]](/icons/layout.gif) | GUIA DE TRABAJO ELABORACION PANEL ELECTRICO (1)-2.pdf | 2026-08-26 22:17 | 338K | |
![[ ]](/icons/layout.gif) | GUIA DE TRABAJO ELABORACION PANEL ELECTRICO (1)-1.pdf | 2026-08-26 22:17 | 338K | |
![[IMG]](/icons/image2.gif) | unnamed.jpg | 2026-08-26 22:18 | 335K | |
![[ ]](/icons/unknown.gif) | Reconocimiento equipos Armando Red.docx | 2026-08-26 22:18 | 329K | |
![[ ]](/icons/layout.gif) | Certificación de pasantia..pdf | 2026-08-26 22:16 | 325K | |
![[ ]](/icons/layout.gif) | Certificación de pasantia.-1.pdf | 2026-08-26 22:16 | 325K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-01-25 at 9.27.53 AM.jpeg | 2026-08-26 22:18 | 316K | |
![[ ]](/icons/compressed.gif) | Facturas-mikrowisp.zip | 2026-08-26 22:17 | 315K | |
![[ ]](/icons/layout.gif) | ilovepdf_merged.pdf | 2026-08-26 22:17 | 313K | |
![[ ]](/icons/layout.gif) | Respuesta a la comunicación DE-0002491-25, vinculada al Caso Núm. 94764.pdf | 2026-08-26 22:18 | 312K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-08-23 at 7.36.18 PM.jpeg | 2026-08-26 22:18 | 310K | |
![[ ]](/icons/layout.gif) | document(6).pdf | 2026-08-26 22:17 | 304K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-09-23 at 08-53-50 división-territorial-2021.pdf.png | 2026-08-26 22:18 | 301K | |
![[ ]](/icons/layout.gif) | Armando Red Planos-Headend.pdf | 2026-08-26 22:16 | 297K | |
![[ ]](/icons/layout.gif) | YUDHELY.pdf | 2026-08-26 22:18 | 291K | |
![[ ]](/icons/unknown.gif) | ~WRL3161.tmp | 2026-08-26 22:18 | 288K | |
![[IMG]](/icons/image2.gif) | ChatGPT Image 11 jun 2026, 16_26_03(1).png | 2026-08-26 22:16 | 285K | |
![[ ]](/icons/layout.gif) | 1762963.pdf | 2026-08-26 22:16 | 282K | |
![[ ]](/icons/layout.gif) | 1762963-1.pdf | 2026-08-26 22:16 | 282K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-15 at 1.19.39 PM.jpeg | 2026-08-26 22:18 | 281K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-10-27 at 9.26.32 PM.jpeg | 2026-08-26 22:18 | 278K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-03-18 at 2.57.30 PM.jpeg | 2026-08-26 22:18 | 275K | |
![[ ]](/icons/layout.gif) | Orden de Compra.pdf | 2026-08-26 22:18 | 274K | |
![[ ]](/icons/layout.gif) | onapiedoc_637689888000000000.pdf | 2026-08-26 22:18 | 272K | |
![[ ]](/icons/layout.gif) | onapiedoc_637689888000000000-4.pdf | 2026-08-26 22:18 | 272K | |
![[ ]](/icons/layout.gif) | onapiedoc_637689888000000000-3.pdf | 2026-08-26 22:18 | 272K | |
![[ ]](/icons/layout.gif) | onapiedoc_637689888000000000-2.pdf | 2026-08-26 22:18 | 272K | |
![[ ]](/icons/layout.gif) | onapiedoc_637689888000000000-1.pdf | 2026-08-26 22:18 | 272K | |
![[ ]](/icons/layout.gif) | Practica de ejercicios para 3ro y 6to.pdf | 2026-08-26 22:18 | 268K | |
![[ ]](/icons/layout.gif) | Declaración_Justificación_de_Ingresos-2(2).pdf | 2026-08-26 22:17 | 264K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(4).jpeg | 2026-08-26 22:18 | 262K | |
![[ ]](/icons/unknown.gif) | Organigrama-General-del-equipo-ejecutivo-de-YouTube-plantilla-.pptx-gratis.pptx | 2026-08-26 22:18 | 260K | |
![[IMG]](/icons/image2.gif) | captura_1745777354.png | 2026-08-26 22:16 | 259K | |
![[ ]](/icons/layout.gif) | orden se servicio ARMANDO RED.pdf | 2026-08-26 22:18 | 244K | |
![[ ]](/icons/layout.gif) | orden se servicio ARMANDO RED-1.pdf | 2026-08-26 22:18 | 244K | |
![[ ]](/icons/layout.gif) | orden se servicio Pirax Velazquez.pdf | 2026-08-26 22:18 | 242K | |
![[ ]](/icons/layout.gif) | 1-600-516855-1.pdf | 2026-08-26 22:16 | 234K | |
![[ ]](/icons/layout.gif) | BRONIN CONTRERAS PEREIRA.pdf | 2026-08-26 22:16 | 234K | |
![[ ]](/icons/layout.gif) | POLIZA 1-600-513997 BRONIN CONTRERAS PEREIRA.pdf | 2026-08-26 22:18 | 234K | |
![[ ]](/icons/layout.gif) | ORDEN DE SERVICIO.pdf | 2026-08-26 22:18 | 228K | |
![[ ]](/icons/layout.gif) | Cedula-1.pdf | 2026-08-26 22:16 | 226K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-11 at 2.39.52 PM.jpeg | 2026-08-26 22:18 | 226K | |
![[ ]](/icons/unknown.gif) | mat.docx | 2026-08-26 22:18 | 225K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-10 at 4.03.23 PM.jpeg | 2026-08-26 22:18 | 223K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM.jpeg | 2026-08-26 22:18 | 222K | |
![[ ]](/icons/layout.gif) | INFOGRAFIA APLICACIONES.pdf | 2026-08-26 22:17 | 222K | |
![[IMG]](/icons/image2.gif) | captura_1769003314.png | 2026-08-26 22:16 | 221K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-01-19 at 7.40.43 PM.jpeg | 2026-08-26 22:18 | 220K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 05 de la 1era Evaluación.pdf | 2026-08-26 22:17 | 216K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 01 de la 2da Evaluación.pdf | 2026-08-26 22:17 | 213K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 01 de la 2da Evaluación-1.pdf | 2026-08-26 22:17 | 213K | |
![[ ]](/icons/layout.gif) | mat.pdf | 2026-08-26 22:18 | 212K | |
![[ ]](/icons/layout.gif) | mat (1).pdf | 2026-08-26 22:18 | 212K | |
![[ ]](/icons/layout.gif) | OFV - Buzon de Mensajes.pdf | 2026-08-26 22:18 | 209K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.54 PM(2).jpeg | 2026-08-26 22:18 | 207K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-12 at 8.51.38 AM.jpeg | 2026-08-26 22:18 | 200K | |
![[ ]](/icons/layout.gif) | Kit de Bienvenida DGII.pdf | 2026-08-26 22:18 | 200K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-05 at 6.19.45 PM.jpeg | 2026-08-26 22:18 | 197K | |
![[ ]](/icons/layout.gif) | maquina de operaciones.pdf | 2026-08-26 22:18 | 195K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 04 de la 1era Evaluación.pdf | 2026-08-26 22:17 | 195K | |
![[ ]](/icons/layout.gif) | DGII Bienvenida.pdf | 2026-08-26 22:17 | 194K | |
![[ ]](/icons/layout.gif) | ARMANDO RED-007725.pdf | 2026-08-26 22:16 | 192K | |
![[IMG]](/icons/image2.gif) | 4230.jpg | 2026-08-26 22:16 | 192K | |
![[ ]](/icons/layout.gif) | RADIO VIS CRIST-000243.pdf | 2026-08-26 22:18 | 190K | |
![[ ]](/icons/layout.gif) | RADIO VIS CRIST-000243-1.pdf | 2026-08-26 22:18 | 190K | |
![[ ]](/icons/layout.gif) | RADIO VIS CRIT-000366.pdf | 2026-08-26 22:18 | 190K | |
![[ ]](/icons/layout.gif) | ActaIncorporacion.aspx dgii.pdf | 2026-08-26 22:16 | 190K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-09-11 at 6.15.33 PM.jpeg | 2026-08-26 22:18 | 188K | |
![[ ]](/icons/layout.gif) | CEDULA.pdf | 2026-08-26 22:16 | 183K | |
![[ ]](/icons/layout.gif) | Plan Reporte Gratuito.pdf | 2026-08-26 22:18 | 182K | |
![[ ]](/icons/layout.gif) | 20250701 - rnc133395861 - Armando Red, srl _ contract v01.docx - Documentos de Google.pdf | 2026-08-26 22:16 | 182K | |
![[ ]](/icons/layout.gif) | 20250701 - rnc133395861 - Armando Red, srl _ contract v01.docx - Documentos de Google-1.pdf | 2026-08-26 22:16 | 182K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 04 de la 2da Evaluación.pdf | 2026-08-26 22:17 | 180K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 02 de la 2da Evaluación.pdf | 2026-08-26 22:17 | 174K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 02 de la 2da Evaluación-1.pdf | 2026-08-26 22:17 | 174K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-17 at 10.56.42 AM.jpeg | 2026-08-26 22:18 | 169K | |
![[ ]](/icons/layout.gif) | Impresion Solicitud.pdf | 2026-08-26 22:17 | 168K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 05 de la 2da Evaluación.pdf | 2026-08-26 22:17 | 166K | |
![[IMG]](/icons/image2.gif) | Sin título.jpg | 2026-08-26 22:18 | 166K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 03 de la 2da Evaluación.pdf | 2026-08-26 22:17 | 166K | |
![[ ]](/icons/layout.gif) | Dibujo Asistido por Computadora, TAREA 03 de la 2da Evaluación (1).pdf | 2026-08-26 22:17 | 166K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-05-13 at 11-34-48 Diagnostics - ARMANDO RED SRL.png | 2026-08-26 22:18 | 163K | |
![[ ]](/icons/unknown.gif) | DALL·E 2024-12-20 11.25.03 - A professional and modern logo design for 'Armando Red,' a business specializing in internet distribution. The logo features a bold red color combined.webp | 2026-08-26 22:17 | 162K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-15 at 8.57.45 AM.jpeg | 2026-08-26 22:18 | 159K | |
![[IMG]](/icons/image2.gif) | LOGO ARMANDO RED SRL.jpg | 2026-08-26 22:18 | 159K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-01 at 10.15.36 AM.jpeg | 2026-08-26 22:18 | 159K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-01 at 10.15.36 AM - copia.jpeg | 2026-08-26 22:18 | 159K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-01 at 10.15.36 AM - copia (3).jpeg | 2026-08-26 22:18 | 159K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-01 at 10.15.36 AM - copia (2).jpeg | 2026-08-26 22:18 | 159K | |
![[ ]](/icons/layout.gif) | COPIA DE MATRICULA SRA CONTRERAS-1.pdf | 2026-08-26 22:17 | 157K | |
![[ ]](/icons/layout.gif) | COPIA DE MATRICULA SRA CONTRERAS-1-2.pdf | 2026-08-26 22:17 | 157K | |
![[ ]](/icons/layout.gif) | COPIA DE MATRICULA SRA CONTRERAS-1-1.pdf | 2026-08-26 22:17 | 157K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-05-23 at 12.05.51 PM.jpeg | 2026-08-26 22:18 | 157K | |
![[TXT]](/icons/text.gif) | 019d4513-0aa7-48fe-9075-178ef735da3f.html | 2026-08-26 22:16 | 155K | |
![[TXT]](/icons/text.gif) | 019d4513-0aa7-48fe-9075-178ef735da3f(1).html | 2026-08-26 22:16 | 155K | |
![[ ]](/icons/layout.gif) | Pártica de cálculo II 1er P. 03-2021.pdf | 2026-08-26 22:18 | 155K | |
![[ ]](/icons/layout.gif) | Pártica de cálculo II 1er P. 03-2021-2.pdf | 2026-08-26 22:18 | 155K | |
![[ ]](/icons/layout.gif) | Pártica de cálculo II 1er P. 03-2021-1.pdf | 2026-08-26 22:18 | 155K | |
![[ ]](/icons/layout.gif) | fibra Drop.pdf | 2026-08-26 22:17 | 154K | |
![[ ]](/icons/unknown.gif) | index-f2-v1-a1.m3u8 | 2026-08-26 22:17 | 153K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-04 at 4.57.35 PM.jpeg | 2026-08-26 22:18 | 150K | |
![[ ]](/icons/layout.gif) | arturo grullon.pdf | 2026-08-26 22:16 | 150K | |
![[ ]](/icons/layout.gif) | union medica.pdf | 2026-08-26 22:18 | 150K | |
![[ ]](/icons/layout.gif) | san vicente de paul.pdf | 2026-08-26 22:18 | 150K | |
![[ ]](/icons/layout.gif) | Disponibilidad Solar por Lotes en Gurabo- Plusval.pdf | 2026-08-26 22:17 | 149K | |
![[ ]](/icons/layout.gif) | Disponibilidad Solar por Lotes en Gurabo- Plusval-1.pdf | 2026-08-26 22:17 | 149K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-23 at 4.37.24 PM.jpeg | 2026-08-26 22:18 | 144K | |
![[ ]](/icons/layout.gif) | LOGO ARMANDO RED SRL.pdf | 2026-08-26 22:18 | 144K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-10-09 at 15-22-12 WhatsApp Business.png | 2026-08-26 22:18 | 144K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-01-30 at 10-40-55 img20260130_10284336.pdf.png | 2026-08-26 22:18 | 144K | |
![[IMG]](/icons/image2.gif) | Cedula-1_page-0001.jpg | 2026-08-26 22:16 | 142K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.54 PM(1).jpeg | 2026-08-26 22:18 | 140K | |
![[ ]](/icons/layout.gif) | OFV - Buzon de Mensajes 2.pdf | 2026-08-26 22:18 | 139K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-29 at 1.20.06 PM.jpeg | 2026-08-26 22:18 | 137K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-01-30 at 10-29-28 img20260130_10284336.pdf.png | 2026-08-26 22:18 | 137K | |
![[ ]](/icons/layout.gif) | UNIVERSIDAD TECNOLOGICA DE SANTIAG1.pdf | 2026-08-26 22:18 | 135K | |
![[ ]](/icons/layout.gif) | UNIVERSIDAD TECNOLOGICA DE SANTIAG1-1.pdf | 2026-08-26 22:18 | 135K | |
![[ ]](/icons/layout.gif) | jajaja.pdf | 2026-08-26 22:17 | 135K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-30 at 11.56.43 AM.jpeg | 2026-08-26 22:18 | 134K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-24 at 10.00.52 AM.jpeg | 2026-08-26 22:18 | 133K | |
![[ ]](/icons/layout.gif) | Documento A4 de Etiquetas Escolares de Fútbol para Cuadernos Ilustrado Celeste y Blanco.pdf | 2026-08-26 22:17 | 133K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2024-11-09 at 6.48.02 PM.jpeg | 2026-08-26 22:18 | 132K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-05-15 at 11.34.15 AM(1).jpeg | 2026-08-26 22:18 | 129K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(5).jpeg | 2026-08-26 22:18 | 128K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(6).jpeg | 2026-08-26 22:18 | 123K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-04-29 at 11-14-39 WhatsApp Business.png | 2026-08-26 22:18 | 121K | |
![[ ]](/icons/layout.gif) | Lista de Usuarios.pdf | 2026-08-26 22:18 | 118K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-04-21 at 3.27.50 PM.jpeg | 2026-08-26 22:18 | 118K | |
![[ ]](/icons/layout.gif) | factura.pdf | 2026-08-26 22:17 | 116K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-01 at 6.22.43 PM.jpeg | 2026-08-26 22:18 | 116K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-28 at 9.46.10 AM.jpeg | 2026-08-26 22:18 | 115K | |
![[ ]](/icons/layout.gif) | Transacciones 20 de julio al 20 de agosto.pdf | 2026-08-26 22:18 | 113K | |
![[ ]](/icons/layout.gif) | Transacciones 20 de julio al 20 de agosto-1.pdf | 2026-08-26 22:18 | 113K | |
![[IMG]](/icons/image2.gif) | horario.png | 2026-08-26 22:17 | 113K | |
![[IMG]](/icons/image2.gif) | horario (3).png | 2026-08-26 22:17 | 113K | |
![[IMG]](/icons/image2.gif) | horario (2).png | 2026-08-26 22:17 | 113K | |
![[IMG]](/icons/image2.gif) | horario (1).png | 2026-08-26 22:17 | 113K | |
![[ ]](/icons/layout.gif) | Poder Autorizacion Representaci - Poder Autorizacion Form.pdf | 2026-08-26 22:18 | 111K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.54 PM.jpeg | 2026-08-26 22:18 | 110K | |
![[ ]](/icons/layout.gif) | OFV - Dirección General de Impuestos Internos.pdf | 2026-08-26 22:18 | 108K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-12 at 12.12.34 PM.jpeg | 2026-08-26 22:18 | 108K | |
![[ ]](/icons/layout.gif) | Cotización - S41070.pdf | 2026-08-26 22:17 | 107K | |
![[ ]](/icons/layout.gif) | Cotización - S41070-1.pdf | 2026-08-26 22:17 | 107K | |
![[IMG]](/icons/image2.gif) | Howls moving castle wallpaper with AI generated.jpeg | 2026-08-26 22:17 | 106K | |
![[ ]](/icons/layout.gif) | OFV - Dirección General de Impuestos Internos deudas.pdf | 2026-08-26 22:18 | 106K | |
![[ ]](/icons/unknown.gif) | BPM_2022.sld | 2026-08-26 22:16 | 105K | |
![[ ]](/icons/layout.gif) | PI to Armando RED.pdf | 2026-08-26 22:18 | 105K | |
![[ ]](/icons/layout.gif) | PI to Armando RED-2.pdf | 2026-08-26 22:18 | 105K | |
![[ ]](/icons/layout.gif) | PI to Armando RED-1.pdf | 2026-08-26 22:18 | 105K | |
![[ ]](/icons/layout.gif) | 119576513B50E38DBAE874F3C7F43197.pdf | 2026-08-26 22:16 | 104K | |
![[ ]](/icons/layout.gif) | 119576513B50E38DBAE874F3C7F43197-1.pdf | 2026-08-26 22:16 | 104K | |
![[ ]](/icons/layout.gif) | Lista de Usuarios-1.pdf | 2026-08-26 22:18 | 104K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-13 at 9.38.01 AM.jpeg | 2026-08-26 22:18 | 102K | |
![[ ]](/icons/layout.gif) | FACTURA06a474a3-7fcb-4149-92fd-d74e5512e787.pdf | 2026-08-26 22:17 | 101K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-06 at 8.51.57 AM.jpeg | 2026-08-26 22:18 | 101K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-28 at 12.23.48 PM.jpeg | 2026-08-26 22:18 | 99K | |
![[ ]](/icons/layout.gif) | Lista de Facturas.pdf | 2026-08-26 22:18 | 97K | |
![[ ]](/icons/layout.gif) | Lista de Facturas-1.pdf | 2026-08-26 22:18 | 97K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-07-31 at 7.56.57 AM.jpeg | 2026-08-26 22:18 | 95K | |
![[ ]](/icons/layout.gif) | FAUSTINO.pdf | 2026-08-26 22:17 | 95K | |
![[IMG]](/icons/image2.gif) | logo.png | 2025-11-06 21:14 | 95K | |
![[ ]](/icons/layout.gif) | 20250701 - rnc133395861 - Armando Red, srl _ SOF v01.docx - Documentos de Google.pdf | 2026-08-26 22:16 | 93K | |
![[ ]](/icons/layout.gif) | 20250701 - rnc133395861 - Armando Red, srl _ SOF v01.docx - Documentos de Google-1.pdf | 2026-08-26 22:16 | 93K | |
![[ ]](/icons/layout.gif) | Curriculum Vitae.pdf | 2026-08-26 22:17 | 93K | |
![[IMG]](/icons/image2.gif) | 22 Cinnamoroll Coloring Pages (Free PDF Printables).jpeg | 2026-08-26 22:16 | 92K | |
![[ ]](/icons/unknown.gif) | Documento.docx | 2026-08-26 22:17 | 91K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-04-27 at 9.09.54 AM.jpeg | 2026-08-26 22:18 | 88K | |
![[ ]](/icons/layout.gif) | Reporte de mi experiencia con inteligencias artificiales nuevas por un periodo muy corto.pdf | 2026-08-26 22:18 | 86K | |
![[ ]](/icons/binary.gif) | wireguard-installer.exe | 2026-08-26 22:18 | 85K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-06-17 at 9.16.40 AM.jpeg | 2026-08-26 22:18 | 83K | |
![[ ]](/icons/layout.gif) | Tabla de Integrales Completa.pdf | 2026-08-26 22:18 | 83K | |
![[ ]](/icons/layout.gif) | Tabla de Integrales Completa-1.pdf | 2026-08-26 22:18 | 83K | |
![[ ]](/icons/layout.gif) | CuentaMovimientos_9609437905_2026-06-05 1128.pdf | 2026-08-26 22:17 | 83K | |
![[ ]](/icons/layout.gif) | 0964a248-cd85-4cc9-adc1-4a1481aaa51e.pdf | 2026-08-26 22:16 | 82K | |
![[ ]](/icons/layout.gif) | PAGO DEDICADO AGOSTO 2026.pdf | 2026-08-26 22:18 | 82K | |
![[ ]](/icons/compressed.gif) | xinput1_3.zip | 2026-08-26 22:18 | 81K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-06-11 at 10.01.24 AM.jpeg | 2026-08-26 22:18 | 81K | |
![[ ]](/icons/layout.gif) | Transferencia a terceros.pdf | 2026-08-26 22:18 | 80K | |
![[ ]](/icons/layout.gif) | Transferencia a terceros-1.pdf | 2026-08-26 22:18 | 80K | |
![[ ]](/icons/layout.gif) | TransferenciaNo14341.pdf | 2026-08-26 22:18 | 80K | |
![[ ]](/icons/layout.gif) | TransferenciaNo14341-1.pdf | 2026-08-26 22:18 | 80K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-09-09 at 8.50.47 PM.jpeg | 2026-08-26 22:18 | 79K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-05-15 at 11.34.14 AM.jpeg | 2026-08-26 22:18 | 79K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-03-19 at 11.43.46 AM.jpeg | 2026-08-26 22:18 | 76K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-04-21 at 3.26.02 PM.jpeg | 2026-08-26 22:18 | 76K | |
![[ ]](/icons/layout.gif) | ARMANDO JUNIO 2026.pdf | 2026-08-26 22:16 | 76K | |
![[ ]](/icons/layout.gif) | Lista de Facturas-2.pdf | 2026-08-26 22:18 | 75K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(2).jpeg | 2026-08-26 22:18 | 75K | |
![[ ]](/icons/layout.gif) | INV_2026_02124.pdf | 2026-08-26 22:17 | 75K | |
![[ ]](/icons/layout.gif) | INV_2026_28169.pdf | 2026-08-26 22:17 | 74K | |
![[ ]](/icons/layout.gif) | Cotización - S00650.pdf | 2026-08-26 22:17 | 74K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-09-25 at 12.48.13 PM.jpeg | 2026-08-26 22:18 | 73K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-09-25 at 12.48.13 PM (1).jpeg | 2026-08-26 22:18 | 73K | |
![[ ]](/icons/unknown.gif) | formulario-persona-fisica-4.xlsx | 2026-08-26 22:17 | 72K | |
![[ ]](/icons/layout.gif) | Lista de Transacciones.pdf | 2026-08-26 22:18 | 72K | |
![[ ]](/icons/layout.gif) | factura (5).pdf | 2026-08-26 22:17 | 71K | |
![[ ]](/icons/layout.gif) | factura (5)-2.pdf | 2026-08-26 22:17 | 71K | |
![[ ]](/icons/layout.gif) | factura (5)-1.pdf | 2026-08-26 22:17 | 71K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-09-10 at 7.15.02 AM.jpeg | 2026-08-26 22:18 | 70K | |
![[IMG]](/icons/image2.gif) | descarga.jpeg | 2026-08-26 22:17 | 69K | |
![[ ]](/icons/layout.gif) | Instrumento para la investigación.pdf | 2026-08-26 22:17 | 69K | |
![[ ]](/icons/layout.gif) | Doc-00011537.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007793.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007470.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007470-1.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | fisica (1).pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | fisica (1)-1.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007472.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007472-1.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00011856.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00007367.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | CONTRERA-003098.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | CONTRERA-003098-1.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00011684.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | Doc-00008444.pdf | 2026-08-26 22:17 | 68K | |
![[ ]](/icons/layout.gif) | YUDELKA RAMOS.pdf | 2026-08-26 22:18 | 67K | |
![[ ]](/icons/layout.gif) | Batista.pdf | 2026-08-26 22:16 | 67K | |
![[ ]](/icons/layout.gif) | Recibo-00011918.pdf | 2026-08-26 22:18 | 67K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-06-03 at 3.11.13 PM.jpeg | 2026-08-26 22:18 | 66K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-24 at 10.45.58 AM.jpeg | 2026-08-26 22:18 | 66K | |
![[ ]](/icons/unknown.gif) | jpg | 2026-08-26 22:18 | 65K | |
![[IMG]](/icons/image2.gif) | White and Colorful Simple Company Structure Organizational Chart.png | 2026-08-26 22:18 | 65K | |
![[IMG]](/icons/image2.gif) | Planificador semanal en PDF ▶【DESCARGA GRATIS】.jpeg | 2026-08-26 22:18 | 64K | |
![[IMG]](/icons/image2.gif) | descarga (1).jpeg | 2026-08-26 22:17 | 62K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-08-04 at 7.07.04 PM.jpeg | 2026-08-26 22:18 | 62K | |
![[ ]](/icons/layout.gif) | CONTRERA-001529.pdf | 2026-08-26 22:17 | 62K | |
![[ ]](/icons/layout.gif) | CONTRERA-07124.pdf | 2026-08-26 22:17 | 62K | |
![[ ]](/icons/layout.gif) | CONTRERA-001164.pdf | 2026-08-26 22:17 | 62K | |
![[ ]](/icons/unknown.gif) | Hoja_de_presupuesto_General_2023_E.xlsx | 2026-08-26 22:17 | 61K | |
![[IMG]](/icons/image2.gif) | istockphoto-1266780681-1024x1024.jpg | 2026-08-26 22:17 | 60K | |
![[ ]](/icons/layout.gif) | 11353.pdf | 2026-08-26 22:16 | 60K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-02-20 at 2.35.37 PM.jpeg | 2026-08-26 22:18 | 59K | |
![[ ]](/icons/layout.gif) | 11513.pdf | 2026-08-26 22:16 | 59K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.54 PM(3).jpeg | 2026-08-26 22:18 | 59K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-02-23 at 3.10.14 PM.jpeg | 2026-08-26 22:18 | 58K | |
![[ ]](/icons/unknown.gif) | clientes.xlsx | 2026-08-26 22:16 | 57K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-11-23 at 5.43.55 PM(3).jpeg | 2026-08-26 22:18 | 53K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-04-27 at 9.09.54 AM (4).jpeg | 2026-08-26 22:18 | 53K | |
![[ ]](/icons/compressed.gif) | ISC-02 (Abril-Jun 2026).zip | 2026-08-26 22:17 | 53K | |
![[IMG]](/icons/image2.gif) | Neutral Beige Minimalist Company Organizational Chart.png | 2026-08-26 22:18 | 52K | |
![[ ]](/icons/unknown.gif) | ~WRL3909.tmp | 2026-08-26 22:18 | 49K | |
![[ ]](/icons/layout.gif) | RADIO VIC CRIST-00086.pdf | 2026-08-26 22:18 | 48K | |
![[ ]](/icons/layout.gif) | RADIO VIC CRIST-00086-2.pdf | 2026-08-26 22:18 | 48K | |
![[ ]](/icons/layout.gif) | RADIO VIC CRIST-00086-1.pdf | 2026-08-26 22:18 | 48K | |
![[ ]](/icons/unknown.gif) | Carta Renuncia Yudhely Vasquez.docx | 2026-08-26 22:16 | 46K | |
![[ ]](/icons/layout.gif) | carta al ministro.pdf | 2026-08-26 22:16 | 44K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2026-06-01 at 7.50.08 PM.jpeg | 2026-08-26 22:18 | 43K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-10-09 at 3.19.28 PM.jpeg | 2026-08-26 22:18 | 43K | |
![[ ]](/icons/unknown.gif) | Obligaciones_Empleador_Armando_Red_Actualizado.docx | 2026-08-26 22:18 | 37K | |
![[ ]](/icons/layout.gif) | Comprobante Nº 00011537 - Doc-00011537 Ynoel.pdf | 2026-08-26 22:16 | 37K | |
![[ ]](/icons/unknown.gif) | Obligaciones_Empleador_Armando_Red.docx | 2026-08-26 22:18 | 37K | |
![[ ]](/icons/unknown.gif) | Plan_Estrategico_ArmandoVideo.docx | 2026-08-26 22:18 | 37K | |
![[ ]](/icons/unknown.gif) | Plan_Estrategico_ArmandoVideo(1).docx | 2026-08-26 22:18 | 37K | |
![[ ]](/icons/layout.gif) | Sailyn Daniel Rodriguez Jorge.pdf | 2026-08-26 22:18 | 37K | |
![[ ]](/icons/unknown.gif) | Estatutos_Armando_Red_EIRL.docx | 2026-08-26 22:17 | 37K | |
![[ ]](/icons/unknown.gif) | Estatutos_Armando_Red_EIRL(2).docx | 2026-08-26 22:17 | 37K | |
![[ ]](/icons/unknown.gif) | Estatutos_Armando_Red_EIRL(1).docx | 2026-08-26 22:17 | 37K | |
![[ ]](/icons/unknown.gif) | Carta_Consolidacion_Faustino_Contreras.docx | 2026-08-26 22:16 | 37K | |
![[ ]](/icons/unknown.gif) | Guía_Configuración_Alarma_NX-8V2.docx | 2026-08-26 22:17 | 36K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-10-09 at 3.37.15 PM.jpeg | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/layout.gif) | recibo.pdf | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/layout.gif) | PDF.js viewer-2.pdf | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/layout.gif) | PDF.js viewer-1.pdf | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/layout.gif) | PDF.js viewer-3.pdf | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/compressed.gif) | xinput1_3 (1).zip | 2026-08-26 22:18 | 36K | |
![[ ]](/icons/layout.gif) | factura de prueba.pdf | 2026-08-26 22:17 | 36K | |
![[IMG]](/icons/image2.gif) | Keroppi icon.jpeg | 2026-08-26 22:18 | 35K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-05-15 at 11.34.15 AM.jpeg | 2026-08-26 22:18 | 35K | |
![[ ]](/icons/layout.gif) | Igle.pdf | 2026-08-26 22:17 | 35K | |
![[ ]](/icons/layout.gif) | RADIO VICION 3.pdf | 2026-08-26 22:18 | 34K | |
![[ ]](/icons/unknown.gif) | factura de prueba.docx | 2026-08-26 22:17 | 34K | |
![[ ]](/icons/layout.gif) | transactionResult.pdf | 2026-08-26 22:18 | 33K | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-05-13 at 11-35-17 Diagnostics - ARMANDO RED SRL.png | 2026-08-26 22:18 | 33K | |
![[ ]](/icons/unknown.gif) | Respuesta a Comunicación DE-0002491-25 Armando Red(2).docx | 2026-08-26 22:18 | 32K | |
![[ ]](/icons/unknown.gif) | Respuesta a Comunicación DE-0002491-25 Armando Red.docx | 2026-08-26 22:18 | 31K | |
![[ ]](/icons/unknown.gif) | Respuesta a Comunicación DE-0002491-25 Armando Red(4).docx | 2026-08-26 22:18 | 31K | |
![[ ]](/icons/unknown.gif) | Respuesta a Comunicación DE-0002491-25 Armando Red(3).docx | 2026-08-26 22:18 | 31K | |
![[ ]](/icons/unknown.gif) | Respuesta a Comunicación DE-0002491-25 Armando Red(1).docx | 2026-08-26 22:18 | 31K | |
![[ ]](/icons/layout.gif) | FA2504-0169.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174-5.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174-4.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174-3.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174-2.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2505-0174-1.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2503-0167.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2503-0167-3.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2503-0167-2.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2503-0167-1.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/unknown.gif) | documento de instalacion.docx | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2506-0181 (1).pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2506-0181 (1)-4.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2506-0181 (1)-3.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2506-0181 (1)-2.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2506-0181 (1)-1.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2502-0166.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2502-0166-2.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | FA2502-0166-1.pdf | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/unknown.gif) | fisica (1).docx | 2026-08-26 22:17 | 31K | |
![[ ]](/icons/layout.gif) | BSA-012795_ENDOSO_152.pdf | 2026-08-26 22:16 | 30K | |
![[ ]](/icons/unknown.gif) | cuestionario 1 electricidad basica ( electrostatica).docx | 2026-08-26 22:17 | 30K | |
![[ ]](/icons/unknown.gif) | cuestionario 1 electricidad basica ( electrostatica)(2).docx | 2026-08-26 22:17 | 30K | |
![[ ]](/icons/unknown.gif) | cuestionario 1 electricidad basica ( electrostatica)(1).docx | 2026-08-26 22:17 | 30K | |
![[ ]](/icons/layout.gif) | exquema02-Modelo.pdf | 2026-08-26 22:17 | 29K | |
![[ ]](/icons/layout.gif) | exquema01-Modelo.pdf | 2026-08-26 22:17 | 29K | |
![[ ]](/icons/layout.gif) | BSA-012795_MARBETE_153.pdf | 2026-08-26 22:16 | 29K | |
![[ ]](/icons/layout.gif) | Documentos266083.pdf | 2026-08-26 22:17 | 29K | |
![[ ]](/icons/layout.gif) | Documentos266083-1.pdf | 2026-08-26 22:17 | 29K | |
![[ ]](/icons/unknown.gif) | Calendario_Obligaciones_Empleador_Armando_Red.docx | 2026-08-26 22:16 | 27K | |
![[ ]](/icons/layout.gif) | Dibujo03-Modelo.pdf | 2026-08-26 22:17 | 27K | |
![[ ]](/icons/unknown.gif) | Carta_Consolidacion_Faustino_Contreras(1).docx | 2026-08-26 22:16 | 27K | |
![[ ]](/icons/unknown.gif) | pensamiento filosofico.docx | 2026-08-26 22:18 | 27K | |
![[ ]](/icons/unknown.gif) | pensam.docx | 2026-08-26 22:18 | 27K | |
![[ ]](/icons/unknown.gif) | Careo No. 2.docx | 2026-08-26 22:16 | 26K | |
![[ ]](/icons/layout.gif) | Image_20250610_0001.pdf | 2026-08-26 22:17 | 26K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2025-06-12 at 10.44.19 AM.jpeg | 2026-08-26 22:18 | 26K | |
![[ ]](/icons/layout.gif) | Informe_Deslinde_Parcela_431.pdf | 2026-08-26 22:17 | 25K | |
![[ ]](/icons/unknown.gif) | compromisos de pagos de Armando Red(Recuperado automáticamente).xlsx | 2026-08-26 22:16 | 24K | |
![[ ]](/icons/unknown.gif) | compromisos de pagos de Armando Red(Recuperado automáticamente)(1).xlsx | 2026-08-26 22:16 | 24K | |
![[ ]](/icons/layout.gif) | COPIA MAATRICULA SHENERAY.pdf | 2026-08-26 22:17 | 23K | |
![[ ]](/icons/layout.gif) | COPIA MAATRICULA SHENERAY-1.pdf | 2026-08-26 22:17 | 23K | |
![[ ]](/icons/unknown.gif) | careo historia dela contabilidad.docx | 2026-08-26 22:16 | 23K | |
![[ ]](/icons/unknown.gif) | careo historia dela contabilidad(1).docx | 2026-08-26 22:16 | 23K | |
![[IMG]](/icons/image2.gif) | logofactura.png | 2024-05-08 16:08 | 23K | |
![[ ]](/icons/unknown.gif) | Ejercicios Calculo de Indice2(1).docx | 2026-08-26 22:17 | 22K | |
![[ ]](/icons/layout.gif) | Armario01-Modelo.pdf | 2026-08-26 22:16 | 21K | |
![[ ]](/icons/layout.gif) | Gráfico de Estructura de Empresa u Organización Organigrama por departamentos multicolor ordenado .pdf.pdf | 2026-08-26 22:17 | 20K | |
![[IMG]](/icons/image2.gif) | 𓆩❤︎𓆪.jpeg | 2026-08-26 22:18 | 20K | |
![[ ]](/icons/compressed.gif) | IST-01-2012.zip | 2026-08-26 22:17 | 19K | |
![[ ]](/icons/compressed.gif) | IST-01-2012(2).zip | 2026-08-26 22:17 | 19K | |
![[ ]](/icons/compressed.gif) | IST-01-2012(1).zip | 2026-08-26 22:17 | 19K | |
![[ ]](/icons/unknown.gif) | ensayo calentamiento global.docx | 2026-08-26 22:17 | 18K | |
![[ ]](/icons/layout.gif) | PDF.js viewer.pdf | 2026-08-26 22:18 | 17K | |
![[ ]](/icons/layout.gif) | carta-miembro.pdf | 2026-08-26 22:16 | 17K | |
![[ ]](/icons/unknown.gif) | DATOS EMPRESA QUE VENDE MIXTO.docx | 2026-08-26 22:17 | 17K | |
![[ ]](/icons/layout.gif) | COTIZACION.pdf | 2026-08-26 22:17 | 16K | |
![[ ]](/icons/layout.gif) | CerAportePersonal_U7723563-3_2026-05-05 13_04_39.pdf | 2026-08-26 22:16 | 14K | |
![[ ]](/icons/layout.gif) | CerAportePersonal_Z7699102-3_2026-04-28 16_30_58.pdf | 2026-08-26 22:16 | 13K | |
![[ ]](/icons/layout.gif) | Dibujo01-Modelo.pdf | 2026-08-26 22:17 | 13K | |
![[ ]](/icons/unknown.gif) | carta de renuncia.docx | 2026-08-26 22:16 | 11K | |
![[ ]](/icons/unknown.gif) | Plan_Salida_Deudas_Armando_Actualizado.xlsx | 2026-08-26 22:18 | 10K | |
![[ ]](/icons/unknown.gif) | Simulacion_Consolidacion_Armando(1).xlsx | 2026-08-26 22:18 | 10K | |
![[ ]](/icons/unknown.gif) | Plan_Salida_Deudas_Armando(1).xlsx | 2026-08-26 22:18 | 10K | |
![[TXT]](/icons/text.gif) | SmartOLT_oltid_1_history_info_2025-07-19_14_50_05.474400.csv | 2026-08-26 22:18 | 9.7K | |
![[ ]](/icons/unknown.gif) | Plantilla_Formato_606_Compras.xlsx | 2026-08-26 22:18 | 8.8K | |
![[ ]](/icons/unknown.gif) | Plantilla_Registro_Compras_Armando_Red (1).xlsx | 2026-08-26 22:18 | 8.6K | |
![[ ]](/icons/unknown.gif) | plantilla-nomina-para-descargar.xlsx | 2026-08-26 22:18 | 8.0K | |
![[ ]](/icons/unknown.gif) | Plan_Salida_Deudas_Armando.xlsx | 2026-08-26 22:18 | 6.4K | |
![[ ]](/icons/unknown.gif) | Simulacion_Consolidacion_Armando.xlsx | 2026-08-26 22:18 | 6.3K | |
![[ ]](/icons/unknown.gif) | Gastos_Deducibles_Armando_Red.xlsx | 2026-08-26 22:17 | 6.2K | |
![[ ]](/icons/unknown.gif) | Plantilla_Control_Mensual_Armando_Red.xlsx | 2026-08-26 22:18 | 5.4K | |
![[TXT]](/icons/text.gif) | SmartOLT_onus_list_2025-11-13_16_37_57.845693.csv | 2026-08-26 22:18 | 5.3K | |
![[ ]](/icons/layout.gif) | Armando_Red_SRL_Registro_Actualizado.pdf | 2026-08-26 22:16 | 4.6K | |
![[ ]](/icons/layout.gif) | Armando_RED_Rotulacion.pdf | 2026-08-26 22:16 | 2.8K | |
![[TXT]](/icons/text.gif) | Lista de Facturas.csv | 2026-08-26 22:18 | 2.5K | |
![[IMG]](/icons/image2.gif) | 320180.jpeg | 2026-08-26 22:16 | 2.3K | |
![[ ]](/icons/layout.gif) | Aportes_de_la_Fisica.pdf | 2026-08-26 22:16 | 2.3K | |
![[ ]](/icons/layout.gif) | Comprobante_CIS.pdf | 2026-08-26 22:16 | 2.1K | |
![[TXT]](/icons/text.gif) | barrios.txt | 2026-08-26 22:16 | 1.8K | |
![[ ]](/icons/layout.gif) | Manual_Programacion_Cerradura.pdf | 2026-08-26 22:18 | 1.7K | |
![[ ]](/icons/compressed.gif) | ArmandoVideoProject.zip | 2026-08-26 22:16 | 1.3K | |
![[ ]](/icons/compressed.gif) | ArmandoVideoProject(2).zip | 2026-08-26 22:16 | 1.3K | |
![[ ]](/icons/compressed.gif) | ArmandoVideoProject(1).zip | 2026-08-26 22:16 | 1.3K | |
![[TXT]](/icons/text.gif) | Calendario_de_Obligaciones_del_Empleador.csv | 2026-08-26 22:16 | 1.0K | |
![[TXT]](/icons/text.gif) | GMT20250206-230541_RecordingnewChat.txt | 2026-08-26 22:17 | 910 | |
![[TXT]](/icons/text.gif) | GMT20250205-230611_RecordingnewChat.txt | 2026-08-26 22:17 | 745 | |
![[TXT]](/icons/text.gif) | GMT20250205-230611_RecordingnewChat(1).txt | 2026-08-26 22:17 | 745 | |
![[SND]](/icons/sound2.gif) | channels(15).m3u | 2026-08-26 22:16 | 671 | |
![[SND]](/icons/sound2.gif) | cn.m3u | 2026-08-26 22:17 | 654 | |
![[SND]](/icons/sound2.gif) | cn(1).m3u | 2026-08-26 22:16 | 654 | |
![[SND]](/icons/sound2.gif) | channels(14).m3u | 2026-08-26 22:16 | 654 | |
![[TXT]](/icons/text.gif) | MainActivity.java | 2026-08-26 22:18 | 598 | |
![[SND]](/icons/sound2.gif) | lista.m3u | 2026-08-26 22:18 | 591 | |
![[SND]](/icons/sound2.gif) | lista(2).m3u | 2026-08-26 22:18 | 591 | |
![[SND]](/icons/sound2.gif) | lista(1).m3u | 2026-08-26 22:18 | 591 | |
![[IMG]](/icons/image2.gif) | Screenshot 2026-01-30 at 10-38-33 Active WLAN Clients.png | 2026-08-26 22:18 | 579 | |
![[TXT]](/icons/text.gif) | GMT20250212-225955_RecordingnewChat.txt | 2026-08-26 22:17 | 568 | |
![[ ]](/icons/unknown.gif) | viw4A8E.tmp | 2026-08-26 22:18 | 537 | |
![[ ]](/icons/unknown.gif) | viw600C.tmp | 2026-08-26 22:18 | 534 | |
![[SND]](/icons/sound2.gif) | channels(13).m3u | 2026-08-26 22:16 | 526 | |
![[SND]](/icons/sound2.gif) | channels(12).m3u | 2026-08-26 22:16 | 526 | |
![[TXT]](/icons/text.gif) | GMT20250211-230144_RecordingnewChat.txt | 2026-08-26 22:17 | 457 | |
![[SND]](/icons/sound2.gif) | channels(6).m3u | 2026-08-26 22:16 | 445 | |
![[SND]](/icons/sound2.gif) | channels(8).m3u | 2026-08-26 22:16 | 436 | |
![[SND]](/icons/sound2.gif) | channels(7).m3u | 2026-08-26 22:16 | 436 | |
![[ ]](/icons/unknown.gif) | tslog.log | 2026-08-26 22:18 | 416 | |
![[SND]](/icons/sound2.gif) | channels(11).m3u | 2026-08-26 22:16 | 397 | |
![[SND]](/icons/sound2.gif) | channels(10).m3u | 2026-08-26 22:16 | 397 | |
![[SND]](/icons/sound2.gif) | channels.m3u | 2026-08-26 22:16 | 393 | |
![[SND]](/icons/sound2.gif) | channels(5).m3u | 2026-08-26 22:16 | 393 | |
![[SND]](/icons/sound2.gif) | channels(3).m3u | 2026-08-26 22:16 | 393 | |
![[SND]](/icons/sound2.gif) | channels(2).m3u | 2026-08-26 22:16 | 393 | |
![[SND]](/icons/sound2.gif) | channels(1).m3u | 2026-08-26 22:16 | 393 | |
![[SND]](/icons/sound2.gif) | channels(4).m3u | 2026-08-26 22:16 | 390 | |
![[ ]](/icons/unknown.gif) | desktop.ini | 2026-08-26 22:17 | 282 | |
![[VID]](/icons/movie.gif) | Just.Mercy.2019.2160p.UHD.BluRay_Remux_DV.HDR.HEVC.Atmos.6xMultiAudio-K4CLUB.mkv | 2026-08-26 22:18 | 273 | |
![[SND]](/icons/sound2.gif) | channels(9).m3u | 2026-08-26 22:16 | 268 | |
![[ ]](/icons/unknown.gif) | 1736f397fed932f7ac7384de7f494cd1(1) | 2026-08-26 22:16 | 245 | |
![[ ]](/icons/unknown.gif) | 1736f397fed932f7ac7384de7f494cd1 | 2026-08-26 22:16 | 241 | |
![[ ]](/icons/unknown.gif) | 8cb16d085bdf677f5c972c0b3d262c84(1) | 2026-08-26 22:16 | 228 | |
![[ ]](/icons/unknown.gif) | 8cb16d085bdf677f5c972c0b3d262c84 | 2026-08-26 22:16 | 228 | |
![[ ]](/icons/unknown.gif) | 9567db4fa1d564e33396a85501d14901(1) | 2026-08-26 22:16 | 214 | |
![[ ]](/icons/unknown.gif) | 9567db4fa1d564e33396a85501d14901 | 2026-08-26 22:16 | 210 | |
![[ ]](/icons/unknown.gif) | 618b0a57ff1c4b87df329864ad1b1294 | 2026-08-26 22:16 | 198 | |
![[ ]](/icons/unknown.gif) | 5ca1ac80bbe2a1106456f0ca12bb0e17 | 2026-08-26 22:16 | 170 | |
![[ ]](/icons/unknown.gif) | b5440a42de8250fa67e281966b3c54e4 | 2026-08-26 22:16 | 168 | |
![[ ]](/icons/unknown.gif) | ~$Plantilla_Registro_Compras_Armando_Red (1).xlsx | 2026-08-26 22:18 | 165 | |
![[ ]](/icons/unknown.gif) | ~$spuesta a Comunicación DE-0002491-25 Armando Red(1).docx | 2026-08-26 22:18 | 162 | |
![[ ]](/icons/unknown.gif) | ~$evo Documento de Microsoft Office Word.docx | 2026-08-26 22:18 | 162 | |
![[ ]](/icons/unknown.gif) | ~$ercicios Calculo de Indice2(1).docx | 2026-08-26 22:18 | 162 | |
![[ ]](/icons/unknown.gif) | ~$conocimiento equipos Armando Red.docx | 2026-08-26 22:18 | 162 | |
![[ ]](/icons/unknown.gif) | ~$conocimiento_equipos_armando_red.docx | 2026-08-26 22:18 | 162 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(7) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(6) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(5) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(4) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(3) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(2) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa(1) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | a5e3df4c954ce930241accff8cca67fa | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | 1c261c87aa1ee2ab02a1843b2dc02f29(1) | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | 1c261c87aa1ee2ab02a1843b2dc02f29 | 2026-08-26 22:16 | 159 | |
![[ ]](/icons/unknown.gif) | da3475a25745c405f57284a61c39c585 | 2026-08-26 22:17 | 154 | |
![[ ]](/icons/unknown.gif) | b381c8f9956d9a47ee38cdb0745643a3 | 2026-08-26 22:16 | 154 | |
![[ ]](/icons/unknown.gif) | f304875fd00b9066a16e1a47c8dfc126 | 2026-08-26 22:17 | 153 | |
![[ ]](/icons/unknown.gif) | f0071ac01fc8a4724acb25061babcdea(1) | 2026-08-26 22:17 | 153 | |
![[ ]](/icons/unknown.gif) | f0071ac01fc8a4724acb25061babcdea | 2026-08-26 22:17 | 153 | |
![[ ]](/icons/unknown.gif) | b81182816ace1498057187de724fe18a | 2026-08-26 22:16 | 152 | |
![[ ]](/icons/unknown.gif) | 495b226ad118088f3ddf30f7dc0fce24 | 2026-08-26 22:16 | 152 | |
![[ ]](/icons/unknown.gif) | c2cee5908e361404f3bcc361ddfeece3 | 2026-08-26 22:16 | 151 | |
![[ ]](/icons/unknown.gif) | af6b83507305fd384402a6d88a7f9906(1) | 2026-08-26 22:16 | 151 | |
![[ ]](/icons/unknown.gif) | af6b83507305fd384402a6d88a7f9906 | 2026-08-26 22:16 | 151 | |
![[ ]](/icons/unknown.gif) | 9567db4fa1d564e33396a85501d14901(2) | 2026-08-26 22:16 | 149 | |
![[VID]](/icons/movie.gif) | GMT20250205-230611_Recording_1920x1080.mp4 | 2026-08-26 22:17 | 110 | |
![[ ]](/icons/unknown.gif) | 506843e1336902bf4bb849de247861a1 | 2026-08-26 22:16 | 108 | |
![[ ]](/icons/unknown.gif) | Armando_Video_v1.apk | 2026-08-26 22:16 | 48 | |
![[TXT]](/icons/text.gif) | fl0ERgrc.htm | 2026-08-26 22:17 | 0 | |
![[ ]](/icons/unknown.gif) | XTV_oficial.apk | 2026-08-26 22:18 | 0 | |
![[ ]](/icons/unknown.gif) | XTV_oficial(1).apk | 2026-08-26 22:18 | 0 | |
![[ ]](/icons/unknown.gif) | Nuevo Documento de Microsoft Office Word.docx | 2026-08-26 22:18 | 0 | |
![[ ]](/icons/binary.gif) | EonVPNSetup.exe | 2026-08-26 22:17 | 0 | |
![[TXT]](/icons/text.gif) | -oS2yPh3.htm | 2026-08-26 22:16 | 0 | |
![[TXT]](/icons/text.gif) | -RBetf3c.htm | 2026-08-26 22:16 | 0 | |
![[DIR]](/icons/folder.gif) | yudely/ | 2026-08-26 22:14 | - | |
![[DIR]](/icons/folder.gif) | xxx/ | 2026-06-03 19:27 | - | |
![[DIR]](/icons/folder.gif) | spider/ | 2026-08-17 04:05 | - | |
![[DIR]](/icons/folder.gif) | pc/ | 2026-08-26 22:16 | - | |
![[DIR]](/icons/folder.gif) | one piece/ | 2026-09-26 02:29 | - | |
![[DIR]](/icons/folder.gif) | music/ | 2026-06-03 19:30 | - | |
![[DIR]](/icons/folder.gif) | curso/ | 2025-12-09 15:59 | - | |
![[DIR]](/icons/folder.gif) | Series/ | 2026-01-22 01:45 | - | |
![[DIR]](/icons/folder.gif) | Ilustración Infográfica Del Sistema Muscular Humano Que Muestra La Anatomía Muscular Del Cuerpo Completo En La Vista Frontal Foto de archivo - Imagen de fondo, realista_ 379067160_files/ | 2026-08-26 22:18 | - | |
![[DIR]](/icons/folder.gif) | Escritorio/ | 2026-08-26 22:21 | - | |
![[DIR]](/icons/folder.gif) | CEDULA/ | 2026-08-26 22:18 | - | |
![[DIR]](/icons/folder.gif) | Autodesk/ | 2026-08-26 22:18 | - | |
![[DIR]](/icons/folder.gif) | 2026/ | 2026-09-02 13:49 | - | |
![[DIR]](/icons/folder.gif) | 2025/ | 2025-12-30 22:38 | - | |
![[DIR]](/icons/folder.gif) | 2024/ | 2025-01-30 01:06 | - | |
|